Package org.eclipse.persistence.jpa.jpql

Source Code of org.eclipse.persistence.jpa.jpql.AbstractContentAssistVisitor$UpdateItemCollectionHelper

/*******************************************************************************
* Copyright (c) 2006, 2012 Oracle and/or its affiliates. All rights reserved.
* This program and the accompanying materials are made available under the
* terms of the Eclipse Public License v1.0 and Eclipse Distribution License v. 1.0
* which accompanies this distribution.
* The Eclipse Public License is available at http://www.eclipse.org/legal/epl-v10.html
* and the Eclipse Distribution License is available at
* http://www.eclipse.org/org/documents/edl-v10.php.
*
* Contributors:
*     Oracle - initial API and implementation
*
******************************************************************************/
package org.eclipse.persistence.jpa.jpql;

import java.util.ArrayList;
import java.util.Collection;
import java.util.Collections;
import java.util.HashMap;
import java.util.List;
import java.util.Map;
import java.util.Stack;
import org.eclipse.persistence.jpa.jpql.AbstractValidator.JPQLQueryBNFValidator;
import org.eclipse.persistence.jpa.jpql.DeclarationResolver.Declaration;
import org.eclipse.persistence.jpa.jpql.parser.AbsExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractConditionalClause;
import org.eclipse.persistence.jpa.jpql.parser.AbstractDoubleEncapsulatedExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractEncapsulatedExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractExpressionVisitor;
import org.eclipse.persistence.jpa.jpql.parser.AbstractFromClause;
import org.eclipse.persistence.jpa.jpql.parser.AbstractPathExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractSchemaName;
import org.eclipse.persistence.jpa.jpql.parser.AbstractSelectClause;
import org.eclipse.persistence.jpa.jpql.parser.AbstractSelectStatement;
import org.eclipse.persistence.jpa.jpql.parser.AbstractSingleEncapsulatedExpression;
import org.eclipse.persistence.jpa.jpql.parser.AbstractTraverseChildrenVisitor;
import org.eclipse.persistence.jpa.jpql.parser.AbstractTraverseParentVisitor;
import org.eclipse.persistence.jpa.jpql.parser.AbstractTripleEncapsulatedExpression;
import org.eclipse.persistence.jpa.jpql.parser.AdditionExpression;
import org.eclipse.persistence.jpa.jpql.parser.AggregateFunction;
import org.eclipse.persistence.jpa.jpql.parser.AllOrAnyExpression;
import org.eclipse.persistence.jpa.jpql.parser.AndExpression;
import org.eclipse.persistence.jpa.jpql.parser.AnonymousExpressionVisitor;
import org.eclipse.persistence.jpa.jpql.parser.ArithmeticExpression;
import org.eclipse.persistence.jpa.jpql.parser.ArithmeticExpressionFactory;
import org.eclipse.persistence.jpa.jpql.parser.ArithmeticFactor;
import org.eclipse.persistence.jpa.jpql.parser.ArithmeticTermBNF;
import org.eclipse.persistence.jpa.jpql.parser.AvgFunction;
import org.eclipse.persistence.jpa.jpql.parser.BadExpression;
import org.eclipse.persistence.jpa.jpql.parser.BetweenExpression;
import org.eclipse.persistence.jpa.jpql.parser.CaseExpression;
import org.eclipse.persistence.jpa.jpql.parser.CaseOperandBNF;
import org.eclipse.persistence.jpa.jpql.parser.CoalesceExpression;
import org.eclipse.persistence.jpa.jpql.parser.CollectionExpression;
import org.eclipse.persistence.jpa.jpql.parser.CollectionMemberDeclaration;
import org.eclipse.persistence.jpa.jpql.parser.CollectionMemberExpression;
import org.eclipse.persistence.jpa.jpql.parser.CollectionValuedPathExpression;
import org.eclipse.persistence.jpa.jpql.parser.CollectionValuedPathExpressionBNF;
import org.eclipse.persistence.jpa.jpql.parser.ComparisonExpression;
import org.eclipse.persistence.jpa.jpql.parser.ComparisonExpressionBNF;
import org.eclipse.persistence.jpa.jpql.parser.ComparisonExpressionFactory;
import org.eclipse.persistence.jpa.jpql.parser.ConcatExpression;
import org.eclipse.persistence.jpa.jpql.parser.ConditionalExpressionBNF;
import org.eclipse.persistence.jpa.jpql.parser.ConstructorExpression;
import org.eclipse.persistence.jpa.jpql.parser.ConstructorItemBNF;
import org.eclipse.persistence.jpa.jpql.parser.CountFunction;
import org.eclipse.persistence.jpa.jpql.parser.DateTime;
import org.eclipse.persistence.jpa.jpql.parser.DeleteClause;
import org.eclipse.persistence.jpa.jpql.parser.DeleteStatement;
import org.eclipse.persistence.jpa.jpql.parser.DivisionExpression;
import org.eclipse.persistence.jpa.jpql.parser.EmptyCollectionComparisonExpression;
import org.eclipse.persistence.jpa.jpql.parser.EncapsulatedIdentificationVariableExpression;
import org.eclipse.persistence.jpa.jpql.parser.EntityTypeLiteral;
import org.eclipse.persistence.jpa.jpql.parser.EntryExpression;
import org.eclipse.persistence.jpa.jpql.parser.ExistsExpression;
import org.eclipse.persistence.jpa.jpql.parser.Expression;
import org.eclipse.persistence.jpa.jpql.parser.ExpressionFactory;
import org.eclipse.persistence.jpa.jpql.parser.ExpressionRegistry;
import org.eclipse.persistence.jpa.jpql.parser.FromClause;
import org.eclipse.persistence.jpa.jpql.parser.FunctionExpression;
import org.eclipse.persistence.jpa.jpql.parser.GroupByClause;
import org.eclipse.persistence.jpa.jpql.parser.GroupByItemBNF;
import org.eclipse.persistence.jpa.jpql.parser.HavingClause;
import org.eclipse.persistence.jpa.jpql.parser.IdentificationVariable;
import org.eclipse.persistence.jpa.jpql.parser.IdentificationVariableDeclaration;
import org.eclipse.persistence.jpa.jpql.parser.IdentifierRole;
import org.eclipse.persistence.jpa.jpql.parser.InExpression;
import org.eclipse.persistence.jpa.jpql.parser.InExpressionItemBNF;
import org.eclipse.persistence.jpa.jpql.parser.IndexExpression;
import org.eclipse.persistence.jpa.jpql.parser.InputParameter;
import org.eclipse.persistence.jpa.jpql.parser.InternalBetweenExpressionBNF;
import org.eclipse.persistence.jpa.jpql.parser.InternalFromClauseBNF;
import org.eclipse.persistence.jpa.jpql.parser.InternalJoinBNF;
import org.eclipse.persistence.jpa.jpql.parser.InternalWhenClauseBNF;
import org.eclipse.persistence.jpa.jpql.parser.JPQLExpression;
import org.eclipse.persistence.jpa.jpql.parser.JPQLGrammar;
import org.eclipse.persistence.jpa.jpql.parser.JPQLQueryBNF;
import org.eclipse.persistence.jpa.jpql.parser.Join;
import org.eclipse.persistence.jpa.jpql.parser.KeyExpression;
import org.eclipse.persistence.jpa.jpql.parser.KeywordExpression;
import org.eclipse.persistence.jpa.jpql.parser.LengthExpression;
import org.eclipse.persistence.jpa.jpql.parser.LikeExpression;
import org.eclipse.persistence.jpa.jpql.parser.LocateExpression;
import org.eclipse.persistence.jpa.jpql.parser.LogicalExpression;
import org.eclipse.persistence.jpa.jpql.parser.LowerExpression;
import org.eclipse.persistence.jpa.jpql.parser.MaxFunction;
import org.eclipse.persistence.jpa.jpql.parser.MinFunction;
import org.eclipse.persistence.jpa.jpql.parser.ModExpression;
import org.eclipse.persistence.jpa.jpql.parser.MultiplicationExpression;
import org.eclipse.persistence.jpa.jpql.parser.NewValueBNF;
import org.eclipse.persistence.jpa.jpql.parser.NotExpression;
import org.eclipse.persistence.jpa.jpql.parser.NullComparisonExpression;
import org.eclipse.persistence.jpa.jpql.parser.NullExpression;
import org.eclipse.persistence.jpa.jpql.parser.NullIfExpression;
import org.eclipse.persistence.jpa.jpql.parser.NumericLiteral;
import org.eclipse.persistence.jpa.jpql.parser.ObjectExpression;
import org.eclipse.persistence.jpa.jpql.parser.OrExpression;
import org.eclipse.persistence.jpa.jpql.parser.OrderByClause;
import org.eclipse.persistence.jpa.jpql.parser.OrderByItem;
import org.eclipse.persistence.jpa.jpql.parser.OrderByItem.Ordering;
import org.eclipse.persistence.jpa.jpql.parser.OrderByItemBNF;
import org.eclipse.persistence.jpa.jpql.parser.QueryPosition;
import org.eclipse.persistence.jpa.jpql.parser.RangeVariableDeclaration;
import org.eclipse.persistence.jpa.jpql.parser.ResultVariable;
import org.eclipse.persistence.jpa.jpql.parser.ScalarExpressionBNF;
import org.eclipse.persistence.jpa.jpql.parser.SelectClause;
import org.eclipse.persistence.jpa.jpql.parser.SelectStatement;
import org.eclipse.persistence.jpa.jpql.parser.SimpleFromClause;
import org.eclipse.persistence.jpa.jpql.parser.SimpleSelectClause;
import org.eclipse.persistence.jpa.jpql.parser.SimpleSelectStatement;
import org.eclipse.persistence.jpa.jpql.parser.SizeExpression;
import org.eclipse.persistence.jpa.jpql.parser.SqrtExpression;
import org.eclipse.persistence.jpa.jpql.parser.StateFieldPathExpression;
import org.eclipse.persistence.jpa.jpql.parser.StringLiteral;
import org.eclipse.persistence.jpa.jpql.parser.StringPrimaryBNF;
import org.eclipse.persistence.jpa.jpql.parser.SubExpression;
import org.eclipse.persistence.jpa.jpql.parser.SubstringExpression;
import org.eclipse.persistence.jpa.jpql.parser.SubtractionExpression;
import org.eclipse.persistence.jpa.jpql.parser.SumFunction;
import org.eclipse.persistence.jpa.jpql.parser.TreatExpression;
import org.eclipse.persistence.jpa.jpql.parser.TrimExpression;
import org.eclipse.persistence.jpa.jpql.parser.TypeExpression;
import org.eclipse.persistence.jpa.jpql.parser.UnknownExpression;
import org.eclipse.persistence.jpa.jpql.parser.UpdateClause;
import org.eclipse.persistence.jpa.jpql.parser.UpdateItem;
import org.eclipse.persistence.jpa.jpql.parser.UpdateStatement;
import org.eclipse.persistence.jpa.jpql.parser.UpperExpression;
import org.eclipse.persistence.jpa.jpql.parser.ValueExpression;
import org.eclipse.persistence.jpa.jpql.parser.WhenClause;
import org.eclipse.persistence.jpa.jpql.parser.WhereClause;
import org.eclipse.persistence.jpa.jpql.spi.IEmbeddable;
import org.eclipse.persistence.jpa.jpql.spi.IEntity;
import org.eclipse.persistence.jpa.jpql.spi.IManagedType;
import org.eclipse.persistence.jpa.jpql.spi.IManagedTypeProvider;
import org.eclipse.persistence.jpa.jpql.spi.IMappedSuperclass;
import org.eclipse.persistence.jpa.jpql.spi.IMapping;
import org.eclipse.persistence.jpa.jpql.spi.IQuery;
import org.eclipse.persistence.jpa.jpql.spi.IType;
import org.eclipse.persistence.jpa.jpql.spi.ITypeDeclaration;
import org.eclipse.persistence.jpa.jpql.spi.ITypeRepository;
import org.eclipse.persistence.jpa.jpql.spi.JPAVersion;
import org.eclipse.persistence.jpa.jpql.util.filter.AndFilter;
import org.eclipse.persistence.jpa.jpql.util.filter.Filter;
import org.eclipse.persistence.jpa.jpql.util.iterator.IterableIterator;

import static org.eclipse.persistence.jpa.jpql.parser.Expression.*;

/**
* The abstract definition that provides support for finding the possible proposals within a JPQL
* query at a certain position.
* <p>
* Provisional API: This interface is part of an interim API that is still under development and
* expected to change significantly before reaching stability. It is available at this early stage
* to solicit feedback from pioneering adopters on the understanding that any code that uses this
* API will almost certainly be broken (repeatedly) as the API evolves.
*
* @version 2.4
* @since 2.4
* @author Pascal Filion
*/
@SuppressWarnings("nls")
public abstract class AbstractContentAssistVisitor extends AnonymousExpressionVisitor {

  /**
   * This visitor determines whether the visited {@link Expression} is the {@link CollectionExpression}.
   */
  private CollectionExpressionVisitor collectionExpressionVisitor;

  /**
   * The context used to query information about the JPQL query.
   */
  protected final JPQLQueryContext context;

  /**
   * This is used to change the position of the cursor in order to add possible proposals
   */
  protected Stack<Integer> corrections;

  /**
   * The cached helpers that are used by this visitor to add valid content assist proposals.
   */
  protected Map<Class<?>, Object> helpers;

  /**
   * Used to prevent and infinite recursion when one of the visit method is virtually asking a
   * child expression to be visited.
   */
  protected Stack<Expression> lockedExpressions;

  /**
   * This visitor determines whether the visited {@link Expression} is the {@link NullExpression}.
   */
  private NullExpressionVisitor nullExpressionVisitor;

  /**
   * Used to determine if the cursor is an expression contained in a collection, if not, then this
   * value is set to -1.
   */
  protected Stack<Integer> positionInCollections;

  /**
   * The set of possible proposals gathered based on the position in the query.
   */
  protected DefaultContentAssistProposals proposals;

  /**
   * Contains the position of the cursor within the parsed {@link Expression}.
   */
  protected QueryPosition queryPosition;

  /**
   * A virtual space is used to move the position by an amount of space in order to find some
   * proposals within an expression. This is usually used when the trailing whitespace is not owned
   * by the child expression but by one of its parents.
   */
  protected Stack<Integer> virtualSpaces;

  /**
   * The current word, which was retrieved from the JPQL based on the position of the cursor.
   * The word is what is on the left side of the cursor.
   */
  protected String word;

  /**
   * This is used to retrieve words from the actual JPQL query.
   */
  protected WordParser wordParser;

  /**
   * A constant for the length of a whitespace, which is 1.
   */
  protected static final int SPACE_LENGTH = 1;

  /**
   * Creates a new <code>AbstractContentAssistVisitor</code>.
   *
   * @param context The context used to query information about the JPQL query
   * @exception NullPointerException The {@link JPQLQueryContext} cannot be <code>null</code>
   */
  protected AbstractContentAssistVisitor(JPQLQueryContext context) {
    super();
    Assert.isNotNull(context, "The JPQLQueryContext cannot be null");
    this.context = context;
    initialize();
  }

  /**
   * Adds the given JPQL identifier as a valid proposal if its role is {@link IdentifierRole#AGGREGATE}
   * and the beginning starts with the current word.
   *
   * @param identifier The JPQL identifier to add as a valid proposal if it passes the checks
   */
  protected void addAggregate(String identifier) {
    if (isAggregate(identifier)) {
      addIdentifier(identifier);
    }
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#AGGREGATE} and the beginning starts with the
   * current word.
   *
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllAggregates(JPQLQueryBNF queryBNF) {
    for (String identifier : queryBNF.getIdentifiers()) {
      addAggregate(identifier);
    }
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#AGGREGATE} and the beginning starts with the
   * current word.
   *
   * @param queryBNFId The unique of the {@link JPQLQueryBNF} for which the registered JPQL
   * identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllAggregates(String queryBNFId) {
    addAllAggregates(getQueryBNF(queryBNFId));
  }

  protected void addAllArithmeticIdentifiers() {
    addAllExpressionFactoryIdentifiers(ArithmeticExpressionFactory.ID);
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#CLAUSE} and the beginning starts with the
   * current word.
   *
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllClauses(JPQLQueryBNF queryBNF) {
    for (String identifier : queryBNF.getIdentifiers()) {
      addClause(identifier);
    }
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#CLAUSE} and the beginning starts with the
   * current word.
   *
   * @param queryBNF The unique identifier of the {@link JPQLQueryBNF} for which the registered
   * JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllClauses(String queryBNF) {
    addAllClauses(getQueryBNF(queryBNF));
  }

  protected void addAllComparisonIdentifiers() {
    addAllExpressionFactoryIdentifiers(ComparisonExpressionFactory.ID);
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#COMPOUND_FUNCTION} and the beginning starts
   * with the current word.
   *
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllCompounds(JPQLQueryBNF queryBNF) {
    for (String identifier : queryBNF.getIdentifiers()) {
      addCompound(identifier);
    }
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#COMPOUND_FUNCTION} and the beginning starts
   * with the current word.
   *
   * @param queryBNFId The unique identifier of the {@link JPQLQueryBNF} for which the registered
   * JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllCompounds(String queryBNFId) {
    addAllCompounds(getQueryBNF(queryBNFId));
  }

  protected void addAllExpressionFactoryIdentifiers(ExpressionFactory expressionFactory) {
    for (String identifier : expressionFactory.identifiers()) {
      proposals.addIdentifier(identifier);
    }
  }

  protected void addAllExpressionFactoryIdentifiers(String expressionFactoryId) {
    addAllExpressionFactoryIdentifiers(
      getExpressionRegistry().getExpressionFactory(expressionFactoryId)
    );
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#FUNCTION} and the beginning starts with the
   * current word.
   *
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllFunctions(JPQLQueryBNF queryBNF) {
    addAllFunctions(queryBNF, queryPosition.getPosition());
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#FUNCTION} and the beginning starts with the
   * current word.
   *
   * @param position The position of the cursor to use for determining if the given JPQL identifier
   * is a valid proposal
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllFunctions(JPQLQueryBNF queryBNF, int position) {
    for (String identifier : queryBNF.getIdentifiers()) {
      addFunction(identifier, position);
    }
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#FUNCTION} and the beginning starts with the
   * current word.
   *
   * @param queryBNFId The unique identifier of the {@link JPQLQueryBNF} for which the registered
   * JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllFunctions(String queryBNFId) {
    addAllFunctions(getQueryBNF(queryBNFId), queryPosition.getPosition());
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if their role is {@link IdentifierRole#FUNCTION} and the beginning starts with the
   * current word.
   *
   * @param queryBNFId The unique identifier of the {@link JPQLQueryBNF} for which the registered
   * JPQL identifiers will be
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllFunctions(String queryBNFId, int position) {
    addAllFunctions(getQueryBNF(queryBNFId), position);
  }

  /**
   * Adds all the identification variables defined in the current query's <b>FROM</b> clause.
   */
  protected void addAllIdentificationVariables() {
    addIdentificationVariables(IdentificationVariableType.ALL, null);
  }

  /**
   * Adds the JPQL identifiers that are registered with the given {@link JPQLQueryBNF} as valid
   * proposals if the beginning starts with the current word.
   *
   * @param queryBNF The {@link JPQLQueryBNF} for which the registered JPQL identifiers will be
   * added as proposals if they pass the checks
   */
  protected void addAllIdentifiers(JPQLQueryBNF queryBNF) {
    for (String identifier : queryBNF.getIdentifiers()) {
      addIdentifier(identifier);
    }
  }

  /**
   * Adds the unique identifier of the JPQL identifiers that are registered with the given {@link
   * JPQLQueryBNF} as valid proposals if the beginning starts with the current word.
   *
   * @param queryBNFId The unique identifier of the {@link JPQLQueryBNF} for which the registered
   * JPQL identifiers will be added as proposals if they pass the checks
   */
  protected void addAllIdentifiers(String queryBNFId) {
    addAllIdentifiers(getQueryBNF(queryBNFId));
  }

  protected void addAllLogicIdentifiers() {
    addIdentifier(AND);
    addIdentifier(OR);
  }

  /**
   * Adds the result variables defined in the <code>SELECT</code> clause as valid proposals.
   */
  protected void addAllResultVariables() {
    addIdentificationVariables(IdentificationVariableType.RESULT_VARIABLE, null);
  }

  /**
   * Adds the given JPQL identifier as a valid proposal if its role is {@link IdentifierRole#CLAUSE}
   * and the beginning starts with the current word.
   *
   * @param identifier The JPQL identifier to add as a valid proposal if it passes the checks
   */
  protected void addClause(String identifier) {
    if (isClause(identifier)) {
      addIdentifier(identifier);
    }
  }

  /**
   * Adds the given JPQL identifier as a valid proposal if its role is {@link IdentifierRole#COMPOUND_FUNCTION}
   * and the beginning starts with the current word.
   *
   * @param identifier The JPQL identifier to add as a valid proposal if it passes the checks
   */
  protected void addCompound(String identifier) {
    if (isCompoundFunction(identifier)) {
      addIdentifier(identifier, queryPosition.getPosition());
    }
  }

  /**
   * Adds the abstract schema types as possible content assist proposals but will be filtered using
   * the current word.
   */
  protected void addEntities() {
    for (IEntity entity : entities()) {
      if (isValidProposal(entity.getName(), word)) {
        proposals.addAbstractSchemaType(entity);
      }
    }
  }

  /**
   * Adds the abstract schema types as possible content assist proposals but will be filtered using
   * the current word and the entity's type will have to match the one from the given {@link IType}.
   *
   * @param type The {@link IType} used to filter the abstract schema types
   */
  protected void addEntities(IType type) {

    for (IEntity entity : entities()) {

      if (isValidProposal(entity.getName(), word) &&
          type.isAssignableTo(entity.getType())) {

        proposals.addAbstractSchemaType(entity);
      }
    }
  }

  /**
   * Adds the given JPQL identifier as a valid proposal if its role is {@link IdentifierRole#FUNCTION}
   * and the beginning starts with the current word.
   *
   * @param position The position of the cursor to use for determining if the given JPQL identifier
   * is a valid proposal
   * @param identifier The JPQL identifier to add as a valid proposal if it passes the checks
   */
  protected void addFunction(String identifier, int position) {
    if (isFunction(identifier)) {
      addIdentifier(identifier, position);
    }
  }

  /**
   * Adds the given identification variable as a valid proposal.
   *
   * @param identificationVariable The identification variable to add as a proposal if it passes
   * the checks
   */
  protected void addIdentificationVariable(String identificationVariable) {

    if (ExpressionTools.stringIsNotEmpty(identificationVariable) &&
        isValidProposal(identificationVariable, word)) {

      proposals.addIdentificationVariable(identificationVariable);
    }
  }

  /**
   * Adds the possible identifier variables as valid proposals but filter them based on the given
   * type.
   * <p>
   * For instance, if the type is {@link IdentificationVariableType#LEFT}, then any identification
   * variables that have been defined before the given {@link Expression} are valid proposals, but
   * those defined after are not valid proposals.
   *
   * @param type Which type of identification variables to add as valid proposals
   * @param expression The {@link Expression} where the content assist was invoked, which helps to
   * determine how to stop adding identification variable
   */
  protected void addIdentificationVariables(IdentificationVariableType type, Expression expression) {

    // Result variable
    if (type == IdentificationVariableType.RESULT_VARIABLE) {
      for (String resultVariable : context.getResultVariables()) {
        addIdentificationVariable(resultVariable);
      }
    }
    else if (type != IdentificationVariableType.NONE) {
      boolean stop = false;

      for (Declaration declaration : context.getDeclarations()) {

        if (stop) {
          break;
        }

        switch (type) {

          // Add the entire list of identification variables (range and collection)
          case ALL: {

            if (declaration.rangeDeclaration) {
              addRangeIdentificationVariable(declaration.getVariableName());
            }
            else {
              addIdentificationVariable(declaration.getVariableName());
            }

            for (String joinIdentificationVariable : declaration.getJoinIdentificationVariables()) {
              addIdentificationVariable(joinIdentificationVariable);
            }

            break;
          }

          // Add only the collection identification variables
          case COLLECTION: {

            if (!declaration.rangeDeclaration) {
              addIdentificationVariable(declaration.getVariableName());

              for (String joinIdentificationVariable : declaration.getJoinIdentificationVariables()) {
                addIdentificationVariable(joinIdentificationVariable);
              }
            }

            break;
          }

          // Add the entire list of identification variables (range and collection) that are
          // defined to the left of the expression
          case LEFT: {

            boolean shouldStop = declaration.declarationExpression.isAncestor(expression);

            if (shouldStop && !declaration.getJoins().contains(expression)) {
              stop = true;
              break;
            }

            if (declaration.rangeDeclaration) {
              addRangeIdentificationVariable(declaration.getVariableName());
            }
            else if (!shouldStop) {
              addIdentificationVariable(declaration.getVariableName());
            }

            for (Map.Entry<Join, String> join : declaration.getJoinEntries()) {
              if (join.getKey().isAncestor(expression)) {
                stop = true;
                break;
              }
              addIdentificationVariable(join.getValue());
            }

            break;
          }

          // Add only the collection identification variables that are
          // defined to the left of the expression
          case LEFT_COLLECTION: {

            boolean shouldStop = declaration.declarationExpression.isAncestor(expression);

            if (shouldStop && (declaration.getJoins().contains(expression))) {
              stop = true;
              break;
            }

            if (!shouldStop && !declaration.rangeDeclaration) {
              addIdentificationVariable(declaration.getVariableName());
            }
            else {
              for (Map.Entry<Join, String> join : declaration.getJoinEntries()) {
                if (join.getKey().isAncestor(expression)) {
                  stop = true;
                  break;
                }
                addIdentificationVariable(join.getValue());
              }
            }

            break;
          }
        }
      }
    }
  }

  /**
   * Adds the given identifier as a proposal if it passes the checks.
   *
   * @param identifier The JPQL identifier to add as a proposal
   */
  protected void addIdentifier(String identifier) {
    addIdentifier(identifier, word);
  }

  /**
   * Adds the given identifier as a proposal. If the JPQL identifier has more than one word, what
   * precedes the given position will be checked in order to filter out some identifiers. For
   * example: "<b>... WHERE IS NOT |</b>" has <code>IS NOT</code> already defined, that means
   * <b>IS NOT EMPTY</b>, <b>IS NOT NULL</b> will be filtered out. The only valid proposals in this
   * case is <b>EMPTY</b> and <b>NULL</b>.
   *
   * @param identifier The JPQL identifier to add as a proposal
   * @param position The position of the cursor to use for determining if the given JPQL identifier
   * is a valid proposal
   */
  protected void addIdentifier(String identifier, int position) {

    position -= word.length();
    boolean found = addIdentifier(identifier, position, "IS NOT ", 2);

    if (!found) {
      found = addIdentifier(identifier, position, "NOT ", 3);

      if (!found) {
        addIdentifier(identifier);
      }
    }
  }

  /**
   * Adds the given identifier as a proposal. If the JPQL identifier has more than one word, what
   * precedes the given position will be checked in order to filter out some identifiers. For
   * example: "<b>... WHERE IS NOT |</b>" has <code>IS NOT</code> already defined, that means
   * <b>IS NOT EMPTY</b>, <b>IS NOT NULL</b> will be filtered out. The only valid proposals in this
   * case is <b>EMPTY</b> and <b>NULL</b>.
   *
   * @param identifier The JPQL identifier to add as a proposal
   * @param position The position of the cursor to use for determining if the given JPQL identifier
   * is a valid proposal
   * @param partialEnding The possible characters that could be identifiers and might be part of
   * a JPQL identifier with more than one word
   * @param endIndex The position used to stop matching the partial ending with what is found
   * before the position of the cursor
   * @return <code>true</code> if the given JPQL identifier was added as a proposal; <code>false</code>
   * otherwise
   */
  protected boolean addIdentifier(String identifier,
                                  int position,
                                  String partialEnding,
                                  int endIndex) {

    for (int index = partialEnding.length(); index > endIndex; index--) {
      String partial = partialEnding.substring(0, index);

      if (wordParser.endsWith(position, partial)) {
        addIdentifier(identifier, partial + word);
        return true;
      }
    }

    return false;
  }

  /**
   * Adds the given proposal as a proposal if it passes the checks.
   *
   * @param identifier The JPQL identifier to add as a proposal
   * @param word The string used to determine if the identifier starts with it
   */
  protected void addIdentifier(String identifier, String word) {

    if (isValidProposal(identifier, word) &&
        isValidVersion(identifier)) {

      proposals.addIdentifier(identifier);
    }
  }

  /**
   * Adds the join specification identifiers as proposals without validation.
   */
  protected void addJoinIdentifiers() {
    proposals.addIdentifier(INNER_JOIN);
    proposals.addIdentifier(INNER_JOIN_FETCH);
    proposals.addIdentifier(JOIN);
    proposals.addIdentifier(JOIN_FETCH);
    proposals.addIdentifier(LEFT_JOIN);
    proposals.addIdentifier(LEFT_JOIN_FETCH);
    proposals.addIdentifier(LEFT_OUTER_JOIN);
    proposals.addIdentifier(LEFT_OUTER_JOIN_FETCH);
  }

  /**
   * Adds the identification variables defined in the current query's <b>FROM</b> clause that are
   * declared before the given {@link Expression}.
   *
   * @param expression The {@link Expression} used to determine at which declaration to stop
   */
  protected void addLeftIdentificationVariables(Expression expression) {
    addIdentificationVariables(IdentificationVariableType.LEFT, expression);
  }

  /**
   * Adds the given identification variable as a proposal if it passes the checks. If an entity is
   * found, then it will be registered.
   */
  protected void addRangeIdentificationVariable(String identificationVariable) {

    if (ExpressionTools.stringIsNotEmpty(identificationVariable) &&
        isValidProposal(identificationVariable, word)) {

      Resolver resolver = context.getResolver(identificationVariable);
      IEntity entity = getEntity(resolver.getType());

      if (entity != null) {
        proposals.addRangeIdentificationVariable(identificationVariable, entity);
      }
      else {
        proposals.addIdentificationVariable(identificationVariable);
      }
    }
  }

  /**
   * Adds the proposals that are valid for a scalar expression.
   */
  protected void addScalarExpressionProposals() {
    addAllIdentificationVariables();
    addEntities();
    addAllFunctions(ScalarExpressionBNF.ID);
  }

  protected void addSelectExpressionProposals(AbstractSelectClause expression, int length) {

    int position = getPosition(expression) - corrections.peek();

    // Now check for inside the select expression
    CollectionExpression collectionExpression = getCollectionExpression(expression.getSelectExpression());

    if (collectionExpression != null) {

      for (int index = 0, count = collectionExpression.childrenSize(); index < count; index++) {
        Expression child = collectionExpression.getChild(index);

        // At the beginning of the child expression
        if (position == length) {
          addAllIdentificationVariables();
          addAllFunctions(expression.selectItemBNF());
          break;
        }
        else {
          boolean withinChild = addSelectExpressionProposals(
            child,
            expression.selectItemBNF(),
            length,
            index,
            index + 1 == count
          );

          if (withinChild) {
            break;
          }
        }

        length += length(child);

        if (collectionExpression.hasComma(index)) {
          length++;
        }
        // Cannot do anything more since a comma is missing,
        // which means the query is not valid
        else {
          break;
        }

        // After ',', the proposals can be added
        if (position == length) {
          addAllIdentificationVariables();
          addAllFunctions(expression.selectItemBNF());
          break;
        }

        if (collectionExpression.hasSpace(index)) {
          length++;
        }
      }
    }
    else {
      addSelectExpressionProposals(
        expression.getSelectExpression(),
        expression.selectItemBNF(),
        length,
        0,
        true
      );
    }
  }

  protected boolean addSelectExpressionProposals(Expression expression,
                                                 String queryBNFId,
                                                 int length,
                                                 int index,
                                                 boolean last) {

    int position = getPosition(expression) - corrections.peek();

    // At the beginning of the child expression
    if (position > 0) {

      if (position == 0) {
        if (index == 0) {
          addIdentifier(DISTINCT);
        }
        addAllIdentificationVariables();
        addAllFunctions(queryBNFId);
      }
      else {
        int childLength = length(expression);

        // At the end of the child expression
        if ((position == length + childLength + virtualSpaces.peek() ||
             position == childLength) &&
            isSelectExpressionComplete(expression)) {

          // Proposals cannot be added if the expression is a result variable
          if (!isResultVariable(expression)) {

            // There is a "virtual" space after the expression, we can add "AS"
            // or the cursor is at the end of the child expression
            if ((virtualSpaces.peek() > 0) || (position == childLength)) {
              proposals.addIdentifier(AS);
            }

            addAllAggregates(queryBNFId);
          }

          return true;
        }
      }
    }

    return false;
  }

  protected boolean areArithmeticSymbolsAppendable(Expression expression) {
    return isValid(expression, ArithmeticTermBNF.ID);
  }

  protected boolean areComparisonSymbolsAppendable(Expression expression) {
    JPQLQueryBNF queryBNF = getQueryBNF(ComparisonExpressionBNF.ID);
    queryBNF.setCompound(false);
    try {
      return isValid(expression, queryBNF);
    }
    finally {
      queryBNF.setCompound(true);
    }
  }

  protected boolean areLogicSymbolsAppendable(Expression expression) {
    return isValid(expression, ConditionalExpressionBNF.ID);
  }

  protected AcceptableTypeVisitor buildAcceptableTypeVisitor() {
    return new AcceptableTypeVisitor();
  }

  protected AppendableExpressionVisitor buildAppendableExpressionVisitor() {
    return new AppendableExpressionVisitor();
  }

  /**
   * Creates a visitor that collects the {@link CollectionExpression} if it's been visited.
   *
   * @return A new {@link CollectionExpressionVisitor}
   */
  protected CollectionExpressionVisitor buildCollectionExpressionVisitor() {
    return new CollectionExpressionVisitor();
  }

  protected CollectionMappingFilter buildCollectionMappingFilter() {
    return new CollectionMappingFilter();
  }

  protected CompoundExpressionHelper buildCompoundExpressionHelper() {
    return new CompoundExpressionHelper();
  }

  protected ConditionalExpressionCompletenessVisitor buildConditionalExpressionCompletenessVisitor() {
    return new ConditionalExpressionCompletenessVisitor();
  }

  protected ConstrutorCollectionHelper buildConstrutorCollectionHelper() {
    return new ConstrutorCollectionHelper();
  }

  protected DefaultMappingCollector buildDefaultMappingCollector() {
    return new DefaultMappingCollector();
  }

  protected DeleteClauseHelper buildDeleteClauseHelper() {
    return new DeleteClauseHelper();
  }

  protected DoubleEncapsulatedCollectionHelper buildDoubleEncapsulatedCollectionHelper() {
    return new DoubleEncapsulatedCollectionHelper();
  }

  protected FilteringMappingCollector buildFilteringMappingCollector(AbstractPathExpression expression,
                                                                     Resolver resolver,
                                                                     Filter<IMapping> filter,
                                                                     String pattern) {

    return new FilteringMappingCollector(
      resolver,
      buildMappingFilter(expression, filter),
      pattern
    );
  }

  protected FromClauseCollectionHelper buildFromClauseCollectionHelper() {
    return new FromClauseCollectionHelper();
  }

  protected FromClauseHelper buildFromClauseHelper() {
    return new FromClauseHelper();
  }

  protected FromClauseSelectStatementHelper buildFromClauseSelectStatementHelper() {
    return new FromClauseSelectStatementHelper();
  }

  protected GroupByClauseCollectionHelper buildGroupByClauseCollectionHelper() {
    return new GroupByClauseCollectionHelper();
  }

  protected GroupByClauseSelectStatementHelper buildGroupByClauseSelectStatementHelper() {
    return new GroupByClauseSelectStatementHelper();
  }

  protected HavingClauseHelper buildHavingClauseHelper() {
    return new HavingClauseHelper();
  }

  protected HavingClauseSelectStatementHelper buildHavingClauseSelectStatementHelper() {
    return new HavingClauseSelectStatementHelper();
  }

  protected IncompleteCollectionExpressionVisitor buildIncompleteCollectionExpressionVisitor() {
    return new IncompleteCollectionExpressionVisitor();
  }

  protected JoinCollectionHelper buildJoinCollectionHelper() {
    return new JoinCollectionHelper();
  }

  /**
   * Returns the {@link JPQLQueryBNFValidator} that can be used to validate an {@link Expression}
   * by making sure its BNF is part of the given BNF.
   *
   * @param queryBNF The BNF used to determine the validity of an {@link Expression}
   * @return A {@link JPQLQueryBNFValidator} that can determine if an {@link Expression} follows
   * the given BNF
   */
  protected JPQLQueryBNFValidator buildJPQLQueryBNFValidator(JPQLQueryBNF queryBNF) {
    return new JPQLQueryBNFValidator(queryBNF);
  }

  /**
   * Returns the {@link JPQLQueryBNFValidator} that can be used to validate an {@link Expression}
   * by making sure its BNF is part of the given BNF.
   *
   * @param queryBNFId The unique identifier of the BNF used to determine the validity of an
   * {@link Expression}
   * @return A {@link JPQLQueryBNFValidator} that can determine if an {@link Expression} follows
   * the given BNF
   */
  protected JPQLQueryBNFValidator buildJPQLQueryBNFValidator(String queryBNFId) {
    return buildJPQLQueryBNFValidator(getQueryBNF(queryBNFId));
  }

  protected MappingCollector buildMappingCollector(AbstractPathExpression expression,
                                                   Resolver resolver,
                                                   Filter<IMapping> filter) {

    return buildFilteringMappingCollector(
      expression,
      resolver,
      filter,
      ExpressionTools.EMPTY_STRING
    );
  }

  protected Filter<IMapping> buildMappingFilter(AbstractPathExpression expression,
                                                Filter<IMapping> filter) {

    // Wrap the filter with another Filter that will make sure only the
    // mappings with the right type will be accepted, for instance, AVG(e.|
    // can only accept state fields with a numeric type
    IType type = getAcceptableType(expression.getParent());

    // No need to filter
    if (type == null) {
      return filter;
    }

    // This will filter the property mappings
    return new AndFilter<IMapping>(new MappingTypeFilter(type), filter);
  }

  protected Filter<IMapping> buildMappingFilter(Expression expression) {
    MappingFilterBuilder visitor = getMappingFilterBuilder();
    try {
      expression.accept(visitor);
      return visitor.filter;
    }
    finally {
      visitor.filter = null;
    }
  }

  protected MappingFilterBuilder buildMappingFilterBuilder() {
    return new MappingFilterBuilder();
  }

  /**
   * Creates a visitor that collects the {@link NullExpression} if it's been visited.
   *
   * @return A new {@link NullExpressionVisitor}
   */
  protected NullExpressionVisitor buildNullExpressionVisitor() {
    return new NullExpressionVisitor();
  }

  protected OrderByClauseCollectionHelper buildOrderByClauseCollectionHelper() {
    return new OrderByClauseCollectionHelper();
  }

  protected OrderByClauseSelectStatementHelper buildOrderByClauseSelectStatementHelper() {
    return new OrderByClauseSelectStatementHelper();
  }

  protected PropertyMappingFilter buildPropertyMappingFilter() {
    return new PropertyMappingFilter();
  }

  /**
   * Prepares this visitor by prepopulating it with the necessary data that is required to properly
   * gather the list of proposals based on the given caret position.
   *
   * @param position The position of the cursor within the JPQL query
   * @return The proposals that are valid choices for the given position
   */
  public ContentAssistProposals buildProposals(int position) {

    JPQLExpression jpqlExpression = getJPQLExpression();

    QueryPosition queryPosition = jpqlExpression.buildPosition(
      getQueryExpression(),
      position
    );

    prepare(queryPosition);
    jpqlExpression.accept(this);
    return proposals;
  }

  protected RangeVariableDeclarationVisitor buildRangeVariableDeclarationVisitor() {
    return new RangeVariableDeclarationVisitor();
  }

  protected ResultVariableVisitor buildResultVariableVisitor() {
    return new ResultVariableVisitor();
  }

  protected SelectClauseCompletenessVisitor buildSelectClauseCompleteness() {
    return new SelectClauseCompletenessVisitor();
  }

  protected SelectClauseSelectStatementHelper buildSelectClauseSelectStatementHelper() {
    return new SelectClauseSelectStatementHelper();
  }

  protected SimpleFromClauseSelectStatementHelper buildSimpleFromClauseSelectStatementHelper() {
    return new SimpleFromClauseSelectStatementHelper();
  }

  protected SimpleGroupByClauseSelectStatementHelper buildSimpleGroupByClauseSelectStatementHelper() {
    return new SimpleGroupByClauseSelectStatementHelper();
  }

  protected SimpleHavingClauseSelectStatementHelper buildSimpleHavingClauseSelectStatementHelper() {
    return new SimpleHavingClauseSelectStatementHelper();
  }

  protected SimpleSelectClauseSelectStatementHelper buildSimpleSelectClauseSelectStatementHelper() {
    return new SimpleSelectClauseSelectStatementHelper();
  }

  protected SimpleWhereClauseSelectStatementHelper buildSimpleWhereClauseSelectStatementHelper() {
    return new SimpleWhereClauseSelectStatementHelper();
  }

  protected SubqueryVisitor buildSubqueryVisitor() {
    return new SubqueryVisitor();
  }

  protected TrailingCompletenessVisitor buildTrailingCompleteness() {
    return new TrailingCompletenessVisitor();
  }

  protected TripleEncapsulatedCollectionHelper buildTripleEncapsulatedCollectionHelper() {
    return new TripleEncapsulatedCollectionHelper();
  }

  protected UpdateItemCollectionHelper buildUpdateItemCollectionHelper() {
    return new UpdateItemCollectionHelper();
  }

  protected VisitParentVisitor buildVisitParentVisitor() {
    return new VisitParentVisitor();
  }

  protected WhereClauseHelper buildWhereClauseHelper() {
    return new WhereClauseHelper();
  }

  protected WhereClauseSelectStatementHelper buildWhereClauseSelectStatementHelper() {
    return new WhereClauseSelectStatementHelper();
  }

  @SuppressWarnings("unchecked")
  protected SelectStatementHelper<AbstractSelectStatement, Expression> cast(
    SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression> helper) {

    return (SelectStatementHelper<AbstractSelectStatement, Expression>) helper;
  }

  /**
   * Disposes this visitor.
   */
  public void dispose() {

    word          = null;
    proposals     = null;
    wordParser    = null;
    queryPosition = null;

    // Not required but during debugging, this is important to be reset
    corrections.setSize(1);
    virtualSpaces.setSize(1);
    lockedExpressions.clear();
    positionInCollections.setSize(1);
  }

  /**
   * Returns the collection of possible abstract schema types.
   *
   * @return The {@link IEntity entities} defined in the persistence context
   */
  protected IterableIterator<IEntity> entities() {
    return getProvider().entities();
  }

  protected int findExpressionPosition(CollectionExpression expression) {

    Expression leafExpression = queryPosition.getExpression();

    if (leafExpression != expression) {
      for (int index = 0, count = expression.childrenSize(); index < count; index++) {
        Expression child = expression.getChild(index);

        if (child.isAncestor(leafExpression)) {
          return index;
        }
      }
    }

    int position = getPosition(expression);

    if (position > -1) {
      for (int index = 0, count = expression.childrenSize(); index < count; index++) {
        Expression child = expression.getChild(index);
        String text = child.toActualText();

        if (position <= text.length()) {
          return index;
        }

        position -= text.length();

        if (expression.hasComma(index)) {
          position--;
        }

        if (expression.hasSpace(index)) {
          position--;
        }
      }
    }

    if (position == 0 && (expression.endsWithComma() || expression.endsWithSpace())) {
      return expression.childrenSize();
    }

    return -1;
  }

  protected RangeVariableDeclaration findRangeVariableDeclaration(UpdateClause expression) {
    RangeVariableDeclarationVisitor visitor = getRangeVariableDeclarationVisitor();
    try {
      expression.getRangeVariableDeclaration().accept(visitor);
      return visitor.expression;
    }
    finally {
      visitor.expression = null;
    }
  }

  /**
   * Determines the root {@link IType} that any type should be assignable. If the {@link IType} is
   * {@link Number}, than any subclasses will be allowed.
   *
   * @param expression The {@link Expression} to visit, including its parent hierarchy until an
   * {@link Expression} requires a certain {@link IType}
   * @return The root {@link IType} allowed or <code>null</code> if anything is allowed
   */
  protected IType getAcceptableType(Expression expression) {
    AcceptableTypeVisitor visitor = getExpressionTypeVisitor();
    try {
      expression.accept(visitor);
      return visitor.type;
    }
    finally {
      visitor.type = null;
    }
  }

  protected AppendableExpressionVisitor getAppendableExpressionVisitor() {
    AppendableExpressionVisitor helper = getHelper(AppendableExpressionVisitor.class);
    if (helper == null) {
      helper = buildAppendableExpressionVisitor();
      registerHelper(AppendableExpressionVisitor.class, helper);
    }
    return helper;
  }

  /**
   * Casts the given {@link Expression} to a {@link CollectionExpression} if it is actually an
   * object of that type.
   *
   * @param expression The {@link Expression} to cast
   * @return The given {@link Expression} if it is a {@link CollectionExpression} or <code>null</code>
   * if it is any other object
   */
  protected CollectionExpression getCollectionExpression(Expression expression) {
    CollectionExpressionVisitor visitor = getCollectionExpressionVisitor();
    try {
      expression.accept(visitor);
      return visitor.expression;
    }
    finally {
      visitor.expression = null;
    }
  }

  /**
   * Returns the visitor that collects the {@link CollectionExpression} if it's been visited.
   *
   * @return The {@link CollectionExpressionVisitor}
   * @see #buildCollectionExpressionVisitor()
   */
  protected CollectionExpressionVisitor getCollectionExpressionVisitor() {
    if (collectionExpressionVisitor == null) {
      collectionExpressionVisitor = buildCollectionExpressionVisitor();
    }
    return collectionExpressionVisitor;
  }

  protected CompletenessVisitor getCompletenessVisitor() {
    TrailingCompletenessVisitor helper = (TrailingCompletenessVisitor) helpers.get(TrailingCompletenessVisitor.class);
    if (helper == null) {
      helper = buildTrailingCompleteness();
      helpers.put(TrailingCompletenessVisitor.class, helper);
    }
    return helper;
  }

  protected CompoundExpressionHelper getCompoundExpressionHelper() {
    CompoundExpressionHelper helper = getHelper(CompoundExpressionHelper.class);
    if (helper == null) {
      helper = buildCompoundExpressionHelper();
      registerHelper(CompoundExpressionHelper.class, helper);
    }
    return helper;
  }

  protected CompletenessVisitor getConditionalExpressionCompletenessVisitor() {
    ConditionalExpressionCompletenessVisitor helper = getHelper(ConditionalExpressionCompletenessVisitor.class);
    if (helper == null) {
      helper = buildConditionalExpressionCompletenessVisitor();
      registerHelper(ConditionalExpressionCompletenessVisitor.class, helper);
    }
    return helper;
  }

  protected ConstrutorCollectionHelper getConstructorCollectionHelper() {
    ConstrutorCollectionHelper helper = getHelper(ConstrutorCollectionHelper.class);
    if (helper == null) {
      helper = buildConstrutorCollectionHelper();
      registerHelper(ConstrutorCollectionHelper.class, helper);
    }
    return helper;
  }

  /**
   * Returns
   *
   * @return
   */
  protected final Stack<Integer> getCorrections() {
    return corrections;
  }

  protected MappingCollector getDefaultMappingCollector() {
    DefaultMappingCollector helper = getHelper(DefaultMappingCollector.class);
    if (helper == null) {
      helper = buildDefaultMappingCollector();
      registerHelper(DefaultMappingCollector.class, helper);
    }
    return helper;
  }

  protected ClauseHelper<DeleteClause> getDeleteClauseHelper() {
    DeleteClauseHelper helper = getHelper(DeleteClauseHelper.class);
    if (helper == null) {
      helper = buildDeleteClauseHelper();
      registerHelper(DeleteClauseHelper.class, helper);
    }
    return helper;
  }

  protected DoubleEncapsulatedCollectionHelper getDoubleEncapsulatedCollectionHelper() {
    DoubleEncapsulatedCollectionHelper helper = getHelper(DoubleEncapsulatedCollectionHelper.class);
    if (helper == null) {
      helper = buildDoubleEncapsulatedCollectionHelper();
      registerHelper(DoubleEncapsulatedCollectionHelper.class, helper);
    }
    return helper;
  }

  /**
   * Retrieves the {@link IEmbeddable} for the given {@link IType} if one exists.
   *
   * @param type The {@link IType} that is mapped as an embeddable
   * @return The given {@link IType} mapped as an embeddable; <code>null</code> if none exists or
   * if it's mapped as a different managed type
   */
  protected IEmbeddable getEmbeddable(IType type) {
    return getProvider().getEmbeddable(type);
  }

  /**
   * Retrieves the {@link IEntity} for the given {@link IType} if one exists.
   *
   * @param type The {@link IType} that is mapped as an entity
   * @return The given {@link IType} mapped as an entity; <code>null</code> if none exists or if
   * it's mapped as a different managed type
   */
  protected IEntity getEntity(IType type) {
    return getProvider().getEntity(type);
  }

  /**
   * Retrieves the entity with the given abstract schema name, which can also be the entity class
   * name.
   *
   * @param entityName The abstract schema name, which can be different from the entity class name
   * but by default, it's the same
   * @return The managed type that has the given name or <code>null</code> if none could be found
   */
  protected IEntity getEntityNamed(String entityName) {
    return getProvider().getEntityNamed(entityName);
  }

  /**
   * Retrieves the registered {@link ExpressionFactory} that was registered for the given unique identifier.
   *
   * @param expressionFactoryId The unique identifier of the {@link ExpressionFactory} to retrieve
   * @return The {@link ExpressionFactory} mapped with the given unique identifier
   */
  protected final ExpressionFactory getExpressionFactory(String expressionFactoryId) {
    return getExpressionRegistry().getExpressionFactory(expressionFactoryId);
  }

  /**
   * Returns the registry containing the {@link JPQLQueryBNF JPQLQueryBNFs} and the {@link
   * org.eclipse.persistence.jpa.jpql.parser.ExpressionFactory ExpressionFactories} that are used
   * to properly parse a JPQL query.
   *
   * @return The registry containing the information related to the JPQL grammar
   */
  protected ExpressionRegistry getExpressionRegistry() {
    return getQueryContext().getExpressionRegistry();
  }

  protected AcceptableTypeVisitor getExpressionTypeVisitor() {
    AcceptableTypeVisitor helper = getHelper(AcceptableTypeVisitor.class);
    if (helper == null) {
      helper = buildAcceptableTypeVisitor();
      registerHelper(AcceptableTypeVisitor.class, helper);
    }
    return helper;
  }

  protected FromClauseCollectionHelper getFromClauseCollectionHelper() {
    FromClauseCollectionHelper helper = getHelper(FromClauseCollectionHelper.class);
    if (helper == null) {
      helper = buildFromClauseCollectionHelper();
      registerHelper(FromClauseCollectionHelper.class, helper);
    }
    return helper;
  }

  protected ClauseHelper<AbstractFromClause> getFromClauseHelper() {
    FromClauseHelper helper = getHelper(FromClauseHelper.class);
    if (helper == null) {
      helper = buildFromClauseHelper();
      registerHelper(FromClauseHelper.class, helper);
    }
    return helper;
  }

  protected FromClauseSelectStatementHelper getFromClauseSelectStatementHelper() {
    FromClauseSelectStatementHelper helper = getHelper(FromClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildFromClauseSelectStatementHelper();
      registerHelper(FromClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  /**
   * Returns the JPQL grammar that will be used to define how to parse a JPQL query.
   *
   * @return The grammar that was used to parse this {@link Expression}
   */
  protected JPQLGrammar getGrammar() {
    return getQueryContext().getGrammar();
  }

  protected GroupByClauseCollectionHelper getGroupByClauseCollectionHelper() {
    GroupByClauseCollectionHelper helper = getHelper(GroupByClauseCollectionHelper.class);
    if (helper == null) {
      helper = buildGroupByClauseCollectionHelper();
      registerHelper(GroupByClauseCollectionHelper.class, helper);
    }
    return helper;
  }

  protected GroupByClauseSelectStatementHelper getGroupByClauseSelectStatementHelper() {
    GroupByClauseSelectStatementHelper helper = getHelper(GroupByClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildGroupByClauseSelectStatementHelper();
      registerHelper(GroupByClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected ClauseHelper<HavingClause> getHavingClauseHelper() {
    HavingClauseHelper helper = getHelper(HavingClauseHelper.class);
    if (helper == null) {
      helper = buildHavingClauseHelper();
      registerHelper(HavingClauseHelper.class, helper);
    }
    return helper;
  }

  protected HavingClauseSelectStatementHelper getHavingClauseSelectStatementHelper() {
    HavingClauseSelectStatementHelper helper = getHelper(HavingClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildHavingClauseSelectStatementHelper();
      registerHelper(HavingClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  /**
   * Retrieves the helper associated with the given helper class.
   *
   * @param helperClass The Java class of the helper to retrieve
   * @return The helper being requested
   */
  @SuppressWarnings("unchecked")
  protected final <T> T getHelper(Class<T> helperClass) {
    return (T) helpers.get(helperClass);
  }

  /**
   * Retrieves the role of the given identifier. A role helps to describe the purpose of the
   * identifier in a query.
   *
   * @param identifier The identifier for which its role is requested
   * @return The role of the given identifier
   */
  protected IdentifierRole getIdentifierRole(String identifier) {
    return getExpressionRegistry().getIdentifierRole(identifier);
  }

  /**
   * Retrieves the JPA version in which the identifier was first introduced.
   *
   * @return The version in which the identifier was introduced
   */
  protected JPAVersion getIdentifierVersion(String identifier) {
    return getExpressionRegistry().getIdentifierVersion(identifier);
  }

  protected CompletenessVisitor getIncompleteCollectionExpressionVisitor() {
    IncompleteCollectionExpressionVisitor helper = getHelper(IncompleteCollectionExpressionVisitor.class);
    if (helper == null) {
      helper = buildIncompleteCollectionExpressionVisitor();
      registerHelper(IncompleteCollectionExpressionVisitor.class, helper);
    }
    return helper;
  }

  protected JoinCollectionHelper getJoinCollectionHelper() {
    JoinCollectionHelper helper = getHelper(JoinCollectionHelper.class);
    if (helper == null) {
      helper = buildJoinCollectionHelper();
      registerHelper(JoinCollectionHelper.class, helper);
    }
    return helper;
  }

  /**
   * Returns the version of the Java Persistence this entity for which it was defined.
   *
   * @return The version of the Java Persistence being used
   */
  protected JPAVersion getJPAVersion() {
    return getQueryContext().getJPAVersion();
  }

  /**
   * Returns the parsed tree representation of the JPQL query.
   *
   * @return The parsed tree representation of the JPQL query
   */
  protected JPQLExpression getJPQLExpression() {
    return context.getJPQLExpression();
  }

  /**
   * Retrieves the entity for the given type.
   *
   * @param type The type that is used as a managed type
   * @return The managed type for the given type, if one exists, <code>null</code> otherwise
   */
  protected IManagedType getManagedType(IType type) {
    return getProvider().getManagedType(type);
  }

  /**
   * Retrieves the {@link IMappedSuperclass} for the given {@link IType} if one exists.
   *
   * @param type The {@link IType} that is mapped as an embeddable
   * @return The given {@link IType} mapped as an mapped super class; <code>null</code> if none
   * exists or if it's mapped as a different managed type
   */
  protected IMappedSuperclass getMappedSuperclass(IType type) {
    return getProvider().getMappedSuperclass(type);
  }

  /**
   * Returns the {@link IMapping} for the field represented by the given {@link Expression}.
   *
   * @param expression The {@link Expression} representing a state field path expression or a
   * collection-valued path expression
   * @return Either the {@link IMapping} or <code>null</code> if none exists
   */
  protected IMapping getMapping(Expression expression) {
    return context.getMapping(expression);
  }

  protected Filter<IMapping> getMappingCollectionFilter() {
    CollectionMappingFilter helper = getHelper(CollectionMappingFilter.class);
    if (helper == null) {
      helper = buildCollectionMappingFilter();
      registerHelper(CollectionMappingFilter.class, helper);
    }
    return helper;
  }

  protected MappingFilterBuilder getMappingFilterBuilder() {
    MappingFilterBuilder helper = (MappingFilterBuilder) helpers.get(MappingFilterBuilder.class);
    if (helper == null) {
      helper = buildMappingFilterBuilder();
      helpers.put(MappingFilterBuilder.class, helper);
    }
    return helper;
  }

  protected Filter<IMapping> getMappingPropertyFilter() {
    PropertyMappingFilter helper = (PropertyMappingFilter) helpers.get(PropertyMappingFilter.class);
    if (helper == null) {
      helper = buildPropertyMappingFilter();
      helpers.put(PropertyMappingFilter.class, helper);
    }
    return helper;
  }

  /**
   * Returns the visitor that collects the {@link NullExpression} if it's been visited.
   *
   * @return The {@link NullExpressionVisitor}
   * @see #buildNullExpressionVisitor()
   */
  protected NullExpressionVisitor getNullExpressionVisitor() {
    if (nullExpressionVisitor == null) {
      nullExpressionVisitor = buildNullExpressionVisitor();
    }
    return nullExpressionVisitor;
  }

  protected OrderByClauseCollectionHelper getOrderByClauseCollectionHelper() {
    OrderByClauseCollectionHelper helper = getHelper(OrderByClauseCollectionHelper.class);
    if (helper == null) {
      helper = buildOrderByClauseCollectionHelper();
      registerHelper(OrderByClauseCollectionHelper.class, helper);
    }
    return helper;
  }

  protected OrderByClauseSelectStatementHelper getOrderByClauseSelectStatementHelper() {
    OrderByClauseSelectStatementHelper helper = getHelper(OrderByClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildOrderByClauseSelectStatementHelper();
      registerHelper(OrderByClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  /**
   * Returns the position of the {@link Expression} within the parsed tree representation of the
   * JPQL query. The beginning of the string representation is the position returned.
   *
   * @param expression The {@link Expression} to find its position in the tree based on the string
   * representation
   * @return The position within the parsed tree of the given {@link Expression}
   */
  protected int getPosition(Expression expression) {
    return queryPosition.getPosition(expression);
  }

  /**
   * Returns the object that contains the valid proposals based on the position of the cursor
   * within the JPQL query.
   *
   * @return The list of proposals
   */
  public DefaultContentAssistProposals getProposals() {
    return proposals;
  }

  /**
   * Retrieves the provider of managed types.
   *
   * @return The object that has access to the application's managed types.
   */
  protected IManagedTypeProvider getProvider() {
    return getQuery().getProvider();
  }

  /**
   * Returns the external form of the JPQL query.
   *
   * @return The external form of the JPQL query
   */
  protected IQuery getQuery() {
    return context.getQuery();
  }

  /**
   * Retrieves the BNF object that was registered for the given unique identifier.
   *
   * @param queryBNFId The unique identifier of the {@link JPQLQueryBNF} to retrieve
   * @return The {@link JPQLQueryBNF} representing a section of the grammar
   */
  protected JPQLQueryBNF getQueryBNF(String queryBNFId) {
    return getExpressionRegistry().getQueryBNF(queryBNFId);
  }

  /**
   * Returns the {@link JPQLQueryContext} that is used by this visitor.
   *
   * @return The {@link JPQLQueryContext} holding onto the JPQL query and the cached information
   */
  protected JPQLQueryContext getQueryContext() {
    return context;
  }

  /**
   * Returns the string representation of the JPQL query.
   *
   * @return A non-<code>null</code> string representation of the JPQL query
   */
  protected String getQueryExpression() {
    return getQuery().getExpression();
  }

  protected RangeVariableDeclarationVisitor getRangeVariableDeclarationVisitor() {
    RangeVariableDeclarationVisitor helper = getHelper(RangeVariableDeclarationVisitor.class);
    if (helper == null) {
      helper = buildRangeVariableDeclarationVisitor();
      registerHelper(RangeVariableDeclarationVisitor.class, helper);
    }
    return helper;
  }

  /**
   * Creates or retrieved the cached {@link Resolver} for the given {@link Expression}. The
   * {@link Resolver} can return the {@link IType} and {@link ITypeDeclaration} of the {@link
   * Expression} and either the {@link IManagedType} or the {@link IMapping}.
   *
   * @param expression The {@link Expression} for which its {@link Resolver} will be retrieved
   * @return {@link Resolver} for the given {@link Expression}
   */
  protected Resolver getResolver(Expression expression) {
    return context.getResolver(expression);
  }

  protected ResultVariableVisitor getResultVariableVisitor() {
    ResultVariableVisitor helper = getHelper(ResultVariableVisitor.class);
    if (helper == null) {
      helper = buildResultVariableVisitor();
      registerHelper(ResultVariableVisitor.class, helper);
    }
    return helper;
  }

  protected CompletenessVisitor getSelectClauseCompletenessVisitor() {
    SelectClauseCompletenessVisitor helper = (SelectClauseCompletenessVisitor) helpers.get(SelectClauseCompletenessVisitor.class);
    if (helper == null) {
      helper = buildSelectClauseCompleteness();
      helpers.put(SelectClauseCompletenessVisitor.class, helper);
    }
    return helper;
  }

  protected SelectClauseSelectStatementHelper getSelectClauseSelectStatementHelper() {
    SelectClauseSelectStatementHelper helper = getHelper(SelectClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSelectClauseSelectStatementHelper();
      registerHelper(SelectClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SimpleFromClauseSelectStatementHelper getSimpleFromClauseSelectStatementHelper() {
    SimpleFromClauseSelectStatementHelper helper = getHelper(SimpleFromClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSimpleFromClauseSelectStatementHelper();
      registerHelper(SimpleFromClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SimpleGroupByClauseSelectStatementHelper getSimpleGroupByClauseSelectStatementHelper() {
    SimpleGroupByClauseSelectStatementHelper helper = getHelper(SimpleGroupByClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSimpleGroupByClauseSelectStatementHelper();
      registerHelper(SimpleGroupByClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SimpleHavingClauseSelectStatementHelper getSimpleHavingClauseSelectStatementHelper() {
    SimpleHavingClauseSelectStatementHelper helper = getHelper(SimpleHavingClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSimpleHavingClauseSelectStatementHelper();
      registerHelper(SimpleHavingClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SimpleSelectClauseSelectStatementHelper getSimpleSelectClauseSelectStatementHelper() {
    SimpleSelectClauseSelectStatementHelper helper = getHelper(SimpleSelectClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSimpleSelectClauseSelectStatementHelper();
      registerHelper(SimpleSelectClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SimpleWhereClauseSelectStatementHelper getSimpleWhereClauseSelectStatementHelper() {
    SimpleWhereClauseSelectStatementHelper helper = getHelper(SimpleWhereClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildSimpleWhereClauseSelectStatementHelper();
      registerHelper(SimpleWhereClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected SubqueryVisitor getSubqueryVisitor() {
    SubqueryVisitor helper = getHelper(SubqueryVisitor.class);
    if (helper == null) {
      helper = buildSubqueryVisitor();
      registerHelper(SubqueryVisitor.class, helper);
    }
    return helper;
  }

  protected TripleEncapsulatedCollectionHelper getTripleEncapsulatedCollectionHelper() {
    TripleEncapsulatedCollectionHelper helper = getHelper(TripleEncapsulatedCollectionHelper.class);
    if (helper == null) {
      helper = buildTripleEncapsulatedCollectionHelper();
      registerHelper(TripleEncapsulatedCollectionHelper.class, helper);
    }
    return helper;
  }

  /**
   * Retrieves the external type for the given Java type.
   *
   * @param type The Java type to wrap with an external form
   * @return The external form of the given type
   */
  protected IType getType(Class<?> type) {
    return getTypeRepository().getType(type);
  }

  /**
   * Returns the {@link IType} of the given {@link Expression}.
   *
   * @param expression The {@link Expression} for which its type will be calculated
   * @return Either the {@link IType} that was resolved by this {@link Resolver} or the
   * {@link IType} for {@link IType#UNRESOLVABLE_TYPE} if it could not be resolved
   */
  protected IType getType(Expression expression) {
    return context.getType(expression);
  }

  /**
   * Retrieves the external class for the given fully qualified class name.
   *
   * @param typeName The fully qualified class name of the class to retrieve
   * @return The external form of the class to retrieve
   */
  protected IType getType(String typeName) {
    return getTypeRepository().getType(typeName);
  }

  /**
   * Returns the {@link ITypeDeclaration} of the field handled by this {@link Resolver}.
   *
   * @param expression The {@link Expression} for which its type declaration will be calculated
   * @return Either the {@link ITypeDeclaration} that was resolved by this {@link Resolver} or the
   * {@link ITypeDeclaration} for {@link IType#UNRESOLVABLE_TYPE} if it could not be resolved
   */
  protected ITypeDeclaration getTypeDeclaration(Expression expression) {
    return context.getTypeDeclaration(expression);
  }

  /**
   * Returns a helper that gives access to the most common {@link IType types}.
   *
   * @return A helper containing a collection of methods related to {@link IType}
   */
  protected TypeHelper getTypeHelper() {
    return getTypeRepository().getTypeHelper();
  }

  /**
   * Returns the type repository for the application.
   *
   * @return The repository of {@link IType ITypes}
   */
  protected ITypeRepository getTypeRepository() {
    return getProvider().getTypeRepository();
  }

  protected UpdateItemCollectionHelper getUpdateItemCollectionHelper() {
    UpdateItemCollectionHelper helper = getHelper(UpdateItemCollectionHelper.class);
    if (helper == null) {
      helper = buildUpdateItemCollectionHelper();
      registerHelper(UpdateItemCollectionHelper.class, helper);
    }
    return helper;
  }

  /**
   * Initializes this visitor.
   */
  protected void initialize() {

    helpers = new HashMap<Class<?>, Object>();
    lockedExpressions = new Stack<Expression>();

    virtualSpaces = new Stack<Integer>();
    virtualSpaces.add(0);

    positionInCollections = new Stack<Integer>();
    positionInCollections.add(-1);

    corrections = new Stack<Integer>();
    corrections.add(0);
  }

  /**
   * Determines whether the given JPQL identifier used in an aggregate expression; for instance
   * <b>AND</b>.
   *
   * @param identifier The identifier to validate
   * @return <code>true</code> if the given identifier is used in an aggregate expression;
   * <code>false</code> otherwise
   */
  protected boolean isAggregate(String identifier) {
    return getIdentifierRole(identifier) == IdentifierRole.AGGREGATE;
  }

  protected boolean isAppendable(Expression expression) {
    AppendableExpressionVisitor visitor = getAppendableExpressionVisitor();
    try {
      expression.accept(visitor);
      return visitor.appendable;
    }
    finally {
      visitor.appendable = false;
    }
  }

  protected boolean isAppendableToCollection(Expression expression) {
    CompletenessVisitor visitor = getIncompleteCollectionExpressionVisitor();
    try {
      expression.accept(visitor);
      return visitor.complete;
    }
    finally {
      visitor.complete = false;
    }
  }

  /**
   * Determines whether the given JPQL identifier used in a clause; for instance <b>SELECT</b>.
   *
   * @param identifier The identifier to validate
   * @return <code>true</code> if the given identifier is a clause; <code>false</code> otherwise
   */
  protected boolean isClause(String identifier) {
    return getIdentifierRole(identifier) == IdentifierRole.CLAUSE;
  }

  protected boolean isComplete(Expression expression) {
    CompletenessVisitor visitor = getCompletenessVisitor();
    try {
      expression.accept(visitor);
      return visitor.complete;
    }
    finally {
      visitor.complete = false;
    }
  }

  protected boolean isCompoundable(Expression expression) {
    CompoundExpressionHelper visitor = getCompoundExpressionHelper();
    try {
      expression.accept(visitor);
      return visitor.isCompoundable();
    }
    finally {
      visitor.dispose();
    }
  }

  /**
   * Determines whether the given JPQL identifier used in a compound expression; an example would
   * be <b>BETWEEN</b> or <b>MEMBER</b>.
   *
   * @param identifier The identifier to validate
   * @return <code>true</code> if the given identifier is used in a compound expression;
   * <code>false</code> otherwise
   */
  protected boolean isCompoundFunction(String identifier) {

    // Only the s full JPQL identifier is valid
    if (identifier == IS || identifier == OF) {
      return false;
    }

    return getIdentifierRole(identifier) == IdentifierRole.COMPOUND_FUNCTION;
  }

  protected boolean isConditionalExpressionComplete(Expression expression) {
    CompletenessVisitor visitor = getConditionalExpressionCompletenessVisitor();
    try {
      expression.accept(visitor);
      return visitor.complete;
    }
    finally {
      visitor.complete = false;
    }
  }

  /**
   * Determines whether the given JPQL identifier is a function, an example would be <b>AVG</b>.
   *
   * @param identifier The identifier to validate
   * @return <code>true</code> if the given identifier is a function; <code>false</code> otherwise
   */
  protected boolean isFunction(String identifier) {
    return getIdentifierRole(identifier) == IdentifierRole.FUNCTION;
  }

  protected boolean isGroupByComplete(Expression expression) {
    // TODO
    CompletenessVisitor visitor = getCompletenessVisitor();
    try {
      expression.accept(visitor);
      return visitor.complete;
    }
    finally {
      visitor.complete = false;
    }
  }

  /**
   * Determines whether the given {@link Expression} is in a subquery or in the top-level query.
   *
   * @param expression The {@link Expression} to visit its parent hierarchy
   * @return <code>true</code> if the owning query is a subquery; <code>false</code> if it's the
   * top-level query
   */
  protected boolean isInSubquery(Expression expression) {
    SubqueryVisitor visitor = getSubqueryVisitor();
    try {
      expression.accept(visitor);
      return visitor.expression != null;
    }
    finally {
      visitor.expression = null;
    }
  }

  /**
   * Determines whether a <code><b>JOIN FETCH</b></code> expression can be identified by with an
   * identification variable or not.
   *
   * @return <code>true</code> if the expression can have an identification variable; false
   * otherwise
   */
  protected abstract boolean isJoinFetchIdentifiable();

  /**
   * Determines whether the given {@link Expression} has been set has the lock to prevent an
   * infinite recursion.
   *
   * @param expression The {@link Expression} to check if it is locked
   * @return <code>true</code> if the given {@link Expression} has been marked as locked;
   * <code>false</code> otherwise
   */
  protected boolean isLocked(Expression expression) {
    return !lockedExpressions.empty() && (lockedExpressions.peek() == expression);
  }

  /**
   * Determines whether the given {@link Expression} is the {@link NullExpression}.
   *
   * @param expression The {@link Expression} to visit
   * @return <code>true</code> if the given {@link Expression} is {@link NullExpression};
   * <code>false</code> otherwise
   */
  protected boolean isNull(Expression expression) {
    NullExpressionVisitor visitor = getNullExpressionVisitor();
    try {
      expression.accept(visitor);
      return visitor.expression != null;
    }
    finally {
      visitor.expression = null;
    }
  }

  /**
   * Determines whether the given position is within the given word.
   * <p>
   * Example: position=0, word="JPQL" => true
   * Example: position=1, word="JPQL" => true
   * Example: position=4, word="JPQL" => true
   * Example: position=5, word="JPQL" => true
   * Example: position=5, offset 2, (actual cursor position is 3), word="JPQL" => true
   *
   * @param position The position of the cursor
   * @param offset The offset to adjust the position
   * @param word The word to check if the cursor is positioned in it
   * @return <code>true</code> if the given position is within the given word; <code>false</code>
   * otherwise
   */
  protected boolean isPositionWithin(int position, int offset, String word) {
    return (position >= offset) && (position - offset <= word.length());
  }

  /**
   * Determines whether the given position is within the given word.
   * <p>
   * Example: position=0, word="JPQL" => true
   * Example: position=1, word="JPQL" => true
   * Example: position=4, word="JPQL" => true
   * Example: position=5, word="JPQL" => true
   *
   * @param position The position of the cursor
   * @param word The word to check if the cursor is positioned in it
   * @return <code>true</code> if the given position is within the given word; <code>false</code>
   * otherwise
   */
  protected boolean isPositionWithin(int position, String word) {
    return isPositionWithin(position, 0, word);
  }

  protected boolean isPreviousClauseComplete(AbstractSelectStatement expression,
                                             SelectStatementHelper<AbstractSelectStatement, Expression> helper) {

    helper = cast(helper.getPreviousHelper());

    if ((helper == null) || !helper.hasClause(expression)) {
      return false;
    }

    Expression clause = helper.getClause(expression);
    Expression clauseExpression = helper.getClauseExpression(clause);
    return helper.isClauseExpressionComplete(clauseExpression);
  }

  protected boolean isResultVariable(Expression expression) {
    ResultVariableVisitor visitor = getResultVariableVisitor();
    try {
      expression.accept(visitor);
      return visitor.expression != null;
    }
    finally {
      visitor.expression = null;
    }
  }

  protected boolean isSelectExpressionComplete(Expression expression) {
    CompletenessVisitor visitor = getSelectClauseCompletenessVisitor();
    try {
      expression.accept(visitor);
      return visitor.complete;
    }
    finally {
      visitor.complete = false;
    }
  }

  /**
   * Determines whether the given {@link Expression} part is an expression of the given query BNF.
   *
   * @param expression The {@link Expression} to validate based on the query BNF
   * @return <code>true</code> if the {@link Expression} part is a child of the given query BNF;
   * <code>false</code> otherwise
   */
  protected boolean isValid(Expression expression, JPQLQueryBNF queryBNF) {
    JPQLQueryBNFValidator validator = buildJPQLQueryBNFValidator(queryBNF);
    try {
      expression.accept(validator);
      return validator.valid;
    }
    finally {
      validator.valid = false;
    }
  }

  /**
   * Determines whether the given {@link Expression} part is an expression of the given query BNF.
   *
   * @param expression The {@link Expression} to validate based on the query BNF
   * @param queryBNFId
   * @return <code>true</code> if the {@link Expression} part is a child of the given query BNF;
   * <code>false</code> otherwise
   */
  protected boolean isValid(Expression expression, String queryBNFId) {
    return isValid(expression, getQueryBNF(queryBNFId));
  }

  /**
   * Determines whether the given proposal is a valid, which is based on the content of the given
   * word. If the word is not an empty string, the proposal must start with the content of the word.
   *
   * @param proposal The proposal to validate
   * @param word The word, which is what was parsed before the position of the cursor
   * @return <code>true</code> if the proposal is valid; <code>false</code> otherwise
   */
  protected boolean isValidProposal(String proposal, String word) {

    // There is no word to match the first letters
    if (word.length() == 0) {
      return true;
    }

    char character = word.charAt(0);

    if (character == '+' ||
        character == '-' ||
        character == '*' ||
        character == '/') {

      return true;
    }

    // The word is longer than the proposal
    if (word.length() > proposal.length()) {
      return false;
    }

    // Check to see if the proposal starts with the word
    for (int index = 0, length = word.length(); index < length; index++) {
      char character1 = proposal.charAt(index);
      char character2 = word  .charAt(index);

      // If characters don't match but case may be ignored, try converting
      // both characters to uppercase. If the results match, then the
      // comparison scan should continue
      char upperCase1 = Character.toUpperCase(character1);
      char upperCase2 = Character.toUpperCase(character2);

      if (upperCase1 != upperCase2) {
        return false;
      }

      // Unfortunately, conversion to uppercase does not work properly for
      // the Georgian alphabet, which has strange rules about case
      // conversion. So we need to make one last check before exiting
      if (Character.toLowerCase(upperCase1) != Character.toLowerCase(upperCase2)) {
        return false;
      }
    }

    return true;
  }

  /**
   * Determines whether the given JPQL identifier can be a valid proposal, i.e. if it's part of the
   * grammar of the JPA version that was used to parse the JPQL query.
   *
   * @param identifier The JPQL identifier to validate
   * @return <code>true</code> if the given identifier is part of the current JPA version or was
   * defined in previous release; <code>false</code> otherwise
   */
  protected boolean isValidVersion(String identifier) {
    JPAVersion identifierVersion = getIdentifierVersion(identifier);
    return getJPAVersion().isNewerThanOrEqual(identifierVersion);
  }

  /**
   * Returns the length of the string representation for the given {@link Expression}. The text
   * containing any virtual text will be used.
   *
   * @param expression The {@link Expression} used to calculate the length of its string
   * representation
   * @return The length of the text, which may contain virtual text
   */
  protected int length(Expression expression) {
    return expression.getLength();
  }

  /**
   * Prepares this visitor by pre-populating it with the necessary data that is required to properly
   * gather the list of proposals based on the caret position.
   *
   * @param queryPosition Contains the position of the cursor within the parsed {@link Expression}
   */
  public void prepare(QueryPosition queryPosition) {

    this.queryPosition = queryPosition;
    this.proposals     = new DefaultContentAssistProposals(getGrammar());

    wordParser = new WordParser(context.getJPQLExpression().toActualText());
    wordParser.setPosition(queryPosition.getPosition());
    word = wordParser.partialWord();
  }

  /**
   * Registers the given helper associated with the given helper class.
   *
   * @param helperClass The Java class of the helper to retrieve
   * @param helper The helper being registered
   * @see #getHelper(Class)
   */
  protected final <T> void registerHelper(Class<T> helperClass, T helper) {
    helpers.put(helperClass, helper);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AbsExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AbstractSchemaName expression) {

    // Adjust the position to be the "beginning" of the expression by adding a "correction"
    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();

    // Add the possible abstract schema names
    addEntities();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AdditionExpression expression) {
    super.visit(expression);
    visitArithmeticExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AllOrAnyExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.NONE, ALL, ANY, SOME);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AndExpression expression) {
    super.visit(expression);
    visitLogicalExpression(expression, AND);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ArithmeticFactor expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // After the arithmetic factor
    if (position == 1) {
      addAllIdentificationVariables();
      addAllFunctions(expression.getQueryBNF());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(AvgFunction expression) {
    super.visit(expression);
    visitAggregateFunction(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(BadExpression expression) {
    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(BetweenExpression expression) {
    super.visit(expression);

    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasExpression()) {
      length += length(expression.getExpression()) + SPACE_LENGTH;
    }

    // Within "NOT BETWEEN" or "BETWEEN"
    if (expression.hasNot() && isPositionWithin(position, length, NOT_BETWEEN) ||
       !expression.hasNot() && isPositionWithin(position, length, BETWEEN)) {

      proposals.addIdentifier(BETWEEN);
      proposals.addIdentifier(NOT_BETWEEN);
    }
    // After "BETWEEN "
    else if (expression.hasSpaceAfterBetween()) {
      length += expression.getIdentifier().length() + SPACE_LENGTH;

      // TODO: Check for the BETWEEN's expression type
      // Right after "BETWEEN "
      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(InternalBetweenExpressionBNF.ID);
      }

      // After lower bound
      if (expression.hasLowerBoundExpression()) {

        // Check for something like "<lower bound> <word>"
        int lowerBoundLength = length(expression.getLowerBoundExpression());

        if (!expression.hasAnd() &&
            (position > length) && (position < length + lowerBoundLength) &&
            isAppendableToCollection(expression.getLowerBoundExpression())) {

          addIdentifier(AND);
        }

        length += lowerBoundLength;

        if (expression.hasSpaceAfterLowerBound()) {
          length++;

          // Right before "AND"
          if (position == length) {
            proposals.addIdentifier(AND);
          }
          else {
            // Within "AND"
            if (expression.hasAnd() && isPositionWithin(position, length, AND)) {
              proposals.addIdentifier(AND);
            }
            // After "AND "
            else if (expression.hasSpaceAfterAnd()) {
              length += AND.length() + SPACE_LENGTH;

              // TODO: Check for the BETWEEN's expression type
              if (position == length) {
                addAllIdentificationVariables();
                addAllFunctions(InternalBetweenExpressionBNF.ID);
              }
            }
            else if (!expression.hasAnd() &&
                      expression.hasUpperBoundExpression()) {

              length += length(expression.getUpperBoundExpression());

              if (position == length) {
                addIdentifier(AND);
              }
            }
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CaseExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within "CASE"
    if (isPositionWithin(position, CASE)) {
      if (isValidVersion(CASE)) {
        proposals.addIdentifier(CASE);
      }
    }
    // After "CASE "
    else if (expression.hasSpaceAfterCase()) {
      int length = CASE.length() + SPACE_LENGTH;

      // Right after "CASE "
      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(CaseOperandBNF.ID);
        proposals.addIdentifier(WHEN);
      }

      // After "<case operand> "
      if (expression.hasCaseOperand() &&
          expression.hasSpaceAfterCaseOperand()) {

        length += length(expression.getCaseOperand()) + SPACE_LENGTH;

        // Right after "<case operand> "
        if (position == length) {
          proposals.addIdentifier(WHEN);
        }
      }

      // After "<when clauses> "
      if (expression.hasWhenClauses() &&
          expression.hasSpaceAfterWhenClauses()) {

        length += length(expression.getWhenClauses()) + SPACE_LENGTH;

        // Right after "<when clauses> "
        if (isPositionWithin(position, length, ELSE)) {
          proposals.addIdentifier(ELSE);
        }

        // After "ELSE "
        if (expression.hasElse() &&
            expression.hasSpaceAfterElse()) {

          length += ELSE.length() + SPACE_LENGTH;

          // Right after "ELSE "
          if (position == length) {
            addAllIdentificationVariables();
            addAllFunctions(CaseOperandBNF.ID);
          }

          // After "<else expression> "
          if (expression.hasElseExpression() &&
              expression.hasSpaceAfterElseExpression()) {

            length += length(expression.getElseExpression()) + SPACE_LENGTH;

            // Right after "<else expression> "
            if (isPositionWithin(position, length, END)) {
              proposals.addIdentifier(END);
            }
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CoalesceExpression expression) {
    super.visit(expression);
    visitEncapsulatedExpression(expression, COALESCE, expression.encapsulatedExpressionBNF());
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CollectionExpression expression) {
    // Adjust the index within the collection
    positionInCollections.add(findExpressionPosition(expression));
    super.visit(expression);
    positionInCollections.pop();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CollectionMemberDeclaration expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within "IN"
    if (isPositionWithin(position, IN)) {
      proposals.addIdentifier(IN);
    }

    // In a subquery only
    // After "IN "
    if (isInSubquery(expression) && expression.hasSpaceAfterIn()) {
      int length = IN.length() + SPACE_LENGTH;

      // Right after "IN "
      if (position == length) {
        // TODO: Type.SuperQueryIdentificationVariable
        addLeftIdentificationVariables(expression);
      }
    }
    // In a top-level query or subquery
    // After "IN("
    else if (expression.hasLeftParenthesis()) {
      int length = IN.length() + 1 /* '(' */;

      // Right after "IN("
      if (position == length) {
        addLeftIdentificationVariables(expression);
        addAllFunctions(CollectionValuedPathExpressionBNF.ID);
      }

      // After "<collection-valued path expression>)"
      if (expression.hasRightParenthesis()) {
        length += length(expression.getCollectionValuedPathExpression()) + 1 /* ')' */;

        // Right after "<collection-valued path expression>)"
        if ((position == length) && !expression.hasSpaceAfterRightParenthesis()) {
          proposals.addIdentifier(AS);
        }

        if (expression.hasSpaceAfterRightParenthesis()) {
          length++;
        }

        // Within "AS"
        if (isPositionWithin(position, length, AS)) {
          proposals.addIdentifier(AS);
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CollectionMemberExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    String identifier = expression.getIdentifier();
    int length = 0;

    if (expression.hasEntityExpression()) {
      length = length(expression.getEntityExpression()) + SPACE_LENGTH;
    }

    // Within the <identifier>
    if (isPositionWithin(position, length, identifier)) {
      proposals.addIdentifier(NOT_MEMBER);
      proposals.addIdentifier(NOT_MEMBER_OF);
      proposals.addIdentifier(MEMBER);
      proposals.addIdentifier(MEMBER_OF);
    }
    // After the <identifier>
    else if (expression.hasOf() && expression.hasSpaceAfterOf() ||
            !expression.hasOf() && expression.hasSpaceAfterMember()) {

      length += identifier.length() + SPACE_LENGTH;

      // Right after the <identifier>
      if (position == length) {
        if (!expression.hasOf()) {
          addIdentifier(OF);
        }
        addAllIdentificationVariables();
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CollectionValuedPathExpression expression) {
    visitPathExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ComparisonExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasLeftExpression()) {
      length += length(expression.getLeftExpression()) + SPACE_LENGTH;
    }

    // Within the comparison operator
    if (isPositionWithin(position, length, expression.getComparisonOperator())) {
      addAllExpressionFactoryIdentifiers(ComparisonExpressionFactory.ID);
    }

    // After the comparison operator
    length += expression.getComparisonOperator().length();

    if (expression.hasSpaceAfterIdentifier()) {
      length++;
    }

    // Right after the comparison operator
    if (position == length) {
      addAllIdentificationVariables();
      addAllFunctions(expression.rightExpressionBNF());
      addAllClauses(expression.rightExpressionBNF());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ConcatExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ConstructorExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // NEW
    if (isPositionWithin(position, NEW)) {
      proposals.addIdentifier(NEW);
    }
    // After "NEW "
    else if (expression.hasSpaceAfterNew()) {
      int length = NEW.length() + SPACE_LENGTH;

      // Right after "NEW "
      if (position == length) {
        // TODO: Show all the instantiable classes
      }

      // After "("
      if (expression.hasLeftParenthesis()) {
        String className = expression.getClassName();
        length += className.length() + SPACE_LENGTH;

        // Right after "("
        if (position == length) {
          addAllIdentificationVariables();
          addAllFunctions(ConstructorItemBNF.ID);
        }
        else {
          visitCollectionExpression(expression, NEW, getConstructorCollectionHelper());
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(CountFunction expression) {
    super.visit(expression);
    visitAggregateFunction(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(DateTime expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within the identifier
    if (expression.isCurrentDate()      && isPositionWithin(position, CURRENT_DATE) ||
        expression.isCurrentTime()      && isPositionWithin(position, CURRENT_TIME) ||
        expression.isCurrentTimestamp() && isPositionWithin(position, CURRENT_TIMESTAMP)) {

      proposals.addIdentifier(CURRENT_DATE);
      proposals.addIdentifier(CURRENT_TIME);
      proposals.addIdentifier(CURRENT_TIMESTAMP);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(DeleteClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitClause(expression, DELETE_FROM, expression.hasSpaceAfterFrom(), getDeleteClauseHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(DeleteStatement expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitDeleteStatement(expression);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(DivisionExpression expression) {
    super.visit(expression);
    visitArithmeticExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(EmptyCollectionComparisonExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasExpression()) {
      length = length(expression.getExpression()) + SPACE_LENGTH;
    }

    // Within the <identifier>
    if (isPositionWithin(position, length, expression.getIdentifier())) {
      proposals.addIdentifier(IS_EMPTY);
      proposals.addIdentifier(IS_NOT_EMPTY);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(EntityTypeLiteral expression) {

    // Adjust the position to be the "beginning" of the expression by adding a "correction"
    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();

    // Add the possible abstract schema names
    addEntities();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(EntryExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.COLLECTION);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ExistsExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.NONE, EXISTS, NOT_EXISTS);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  protected void visit(Expression expression) {
    expression.getParent().accept(this);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(FromClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitCollectionExpression(expression, FROM, getFromClauseCollectionHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(FunctionExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(GroupByClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitCollectionExpression(expression, GROUP_BY, getGroupByClauseCollectionHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(HavingClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitClause(expression, HAVING, expression.hasSpaceAfterIdentifier(), getHavingClauseHelper());
      visitCompoundableExpression(expression);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(IdentificationVariable expression) {
    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(IdentificationVariableDeclaration expression) {
    super.visit(expression);

    // After the range variable declaration
    if (expression.hasSpace()) {
      int position = getPosition(expression) - corrections.peek();
      int length = length(expression.getRangeVariableDeclaration()) + SPACE_LENGTH;

      // Right after the range variable declaration
      if (position == length) {
        addJoinIdentifiers();
      }
      else {
        visitCollectionExpression(expression, ExpressionTools.EMPTY_STRING, getJoinCollectionHelper());
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(IndexExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(InExpression expression) {
    expression.accept(visitParentVisitor());

    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasExpression()) {
      length += length(expression.getExpression()) + SPACE_LENGTH;
    }

    // Within "IN"
    if (isPositionWithin(position, length, expression.getIdentifier())) {
      proposals.addIdentifier(IN);
      proposals.addIdentifier(NOT_IN);
    }
    // After "IN("
    else if (expression.hasLeftParenthesis()) {
      length += expression.getIdentifier().length() + SPACE_LENGTH;

      // Right after "IN("
      if (position == length) {
        addAllFunctions(InExpressionItemBNF.ID);
        proposals.addIdentifier(SELECT);
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(InputParameter expression) {
    // No content assist can be provider for an input parameter
    super.visit(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(Join expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    String identifier = expression.getIdentifier();
    boolean joinFetch = expression.hasFetch();

    // Within "<join>"
    if (isPositionWithin(position, identifier)) {

      // Add JOIN identifiers
      proposals.addIdentifier(JOIN);
      proposals.addIdentifier(INNER_JOIN);
      proposals.addIdentifier(LEFT_JOIN);
      proposals.addIdentifier(LEFT_OUTER_JOIN);

      // Add JOIN FETCH identifiers if allowed or
      // if there is no 'AS identification_variable'
      if (isJoinFetchIdentifiable() ||
         !expression.hasAs() && !expression.hasIdentificationVariable()) {

        proposals.addIdentifier(JOIN_FETCH);
        proposals.addIdentifier(INNER_JOIN_FETCH);
        proposals.addIdentifier(LEFT_JOIN_FETCH);
        proposals.addIdentifier(LEFT_OUTER_JOIN_FETCH);
      }
    }
    // After "<join> "
    else if (expression.hasSpaceAfterJoin()) {
      int length = identifier.length() + SPACE_LENGTH;

      // Right after "<join> "
      if (position == length) {

        // Only add some JOIN identifiers if the actual identifier is shorter or incomplete
        if (identifier == LEFT) {
          addIdentifier(LEFT_JOIN);
          addIdentifier(LEFT_OUTER_JOIN);

          if (isJoinFetchIdentifiable() ||
              !expression.hasAs() && !expression.hasIdentificationVariable()) {

            addIdentifier(LEFT_JOIN_FETCH);
            addIdentifier(LEFT_OUTER_JOIN_FETCH);
          }
        }
        else if (identifier == INNER) {
          addIdentifier(INNER_JOIN);

          if (isJoinFetchIdentifiable() ||
              !expression.hasAs() && !expression.hasIdentificationVariable()) {

            addIdentifier(INNER_JOIN_FETCH);
          }
        }
        else if (identifier.equals("LEFT_OUTER")) {
          addIdentifier(LEFT_OUTER_JOIN);

          if (isJoinFetchIdentifiable() ||
              !expression.hasAs() && !expression.hasIdentificationVariable()) {

            addIdentifier(LEFT_OUTER_JOIN_FETCH);
          }
        }
        else {
          addLeftIdentificationVariables(expression);
        }
      }

      // After "join association path expression "
      if (expression.hasJoinAssociationPath() &&
          expression.hasSpaceAfterJoinAssociation()) {

        length += length(expression.getJoinAssociationPath()) + SPACE_LENGTH;

        // Right after "join association path expression "
        // Make sure to verify if AS can be added if it's a JOIN FETCH expression
        if (!joinFetch || joinFetch && isJoinFetchIdentifiable()) {
          if (isPositionWithin(position, length, AS)) {
            addIdentifier(AS);
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(JPQLExpression expression) {

    if (!isLocked(expression)) {

      int position = getPosition(expression);

      // At the beginning of the query
      if (position == 0) {
        addIdentifier(SELECT);
        addIdentifier(UPDATE);
        addIdentifier(DELETE_FROM);
      }
      else {
        Expression queryStatement = expression.getQueryStatement();
        boolean hasQueryStatement = expression.hasQueryStatement();
        int length = hasQueryStatement ? length(queryStatement) : 0;

        // After the query, inside the invalid query (or ending whitespace)
        if (position > length) {
          String text = expression.getUnknownEndingStatement().toActualText();

          // Only try to add the identifiers if there is no query statement,
          // they cannot be added at the end of a query
          if (!hasQueryStatement) {
            addIdentifier(SELECT,      text);
            addIdentifier(DELETE_FROM, text);
            addIdentifier(UPDATE,      text);
          }
          else {

            lockedExpressions.add(expression);
            corrections.add(-length - 2); // -2 because the position of any Expression is -1

            queryStatement.accept(this);

            corrections.pop();
            lockedExpressions.pop();
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(KeyExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.LEFT_COLLECTION);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(KeywordExpression expression) {

    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();

    int position = getPosition(expression) - corrections.peek();
    String keyword = expression.getText();

    // Within the identifier
    if ((keyword == TRUE&& isPositionWithin(position, TRUE||
        (keyword == FALSE) && isPositionWithin(position, FALSE) ||
        (keyword == NULL&& isPositionWithin(position, NULL)) {

      proposals.addIdentifier(TRUE);
      proposals.addIdentifier(FALSE);
      proposals.addIdentifier(NULL);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(LengthExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(LikeExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasStringExpression()) {
      length += length(expression.getStringExpression()) + SPACE_LENGTH;
    }

    // Within "LIKE" or "NOT LIKE"
    if (isPositionWithin(position, length, expression.getIdentifier())) {
      proposals.addIdentifier(LIKE);
      proposals.addIdentifier(NOT_LIKE);
    }
    // After "LIKE " or "NOT LIKE "
    else if (expression.hasSpaceAfterLike()) {
      length += expression.getIdentifier().length() + SPACE_LENGTH;

      // After "<pattern value> "
      if (expression.hasPatternValue() &&
          expression.hasSpaceAfterPatternValue()) {

        length += length(expression.getPatternValue()) + SPACE_LENGTH;

        // Within "ESCAPE"
        if (isPositionWithin(position, length, ESCAPE)) {
          proposals.addIdentifier(ESCAPE);
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(LocateExpression expression) {
    super.visit(expression);
    visitCollectionExpression(expression, LOCATE, getTripleEncapsulatedCollectionHelper());
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(LowerExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(MaxFunction expression) {
    super.visit(expression);
    visitAggregateFunction(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(MinFunction expression) {
    super.visit(expression);
    visitAggregateFunction(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ModExpression expression) {
    super.visit(expression);
    visitCollectionExpression(expression, MOD, getDoubleEncapsulatedCollectionHelper());
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(MultiplicationExpression expression) {
    super.visit(expression);
    visitArithmeticExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(NotExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within "NOT
    if (isPositionWithin(position, NOT)) {
      proposals.addIdentifier(NOT);

      // Also add the negated JPQL identifiers
      if (!expression.hasExpression()) {
        int currentPosition = queryPosition.getPosition();
        addIdentifier(NOT_BETWEEN,   currentPosition);
        addIdentifier(NOT_EXISTS,    currentPosition);
        addIdentifier(NOT_IN,        currentPosition);
        addIdentifier(NOT_LIKE,      currentPosition);
        addIdentifier(NOT_MEMBER,    currentPosition);
        addIdentifier(NOT_MEMBER_OF, currentPosition);

        // In case IS is in the query right before NOT
        addIdentifier(IS_NOT_EMPTY,  currentPosition);
        addIdentifier(IS_NOT_NULL,   currentPosition);
      }
    }
    // After "NOT "
    else if (expression.hasSpaceAfterNot()) {
      int length = NOT.length() + SPACE_LENGTH;

      // Right after "NOT "
      if (position == length) {
        boolean canAddCompoundIdentifiers = !expression.hasExpression();

        if (!canAddCompoundIdentifiers) {
          String variableName = context.literal(
            expression.getExpression(),
            LiteralType.IDENTIFICATION_VARIABLE
          );
          canAddCompoundIdentifiers = ExpressionTools.stringIsNotEmpty(variableName);
        }

        if (canAddCompoundIdentifiers) {
          int currentPosition = queryPosition.getPosition();
          addIdentifier(NOT_BETWEEN,   currentPosition);
          addIdentifier(NOT_EXISTS,    currentPosition);
          addIdentifier(NOT_IN,        currentPosition);
          addIdentifier(NOT_LIKE,      currentPosition);
          addIdentifier(NOT_MEMBER,    currentPosition);
          addIdentifier(NOT_MEMBER_OF, currentPosition);

          // In case IS is in the query right before NOT
          addIdentifier(IS_NOT_EMPTY,  currentPosition);
          addIdentifier(IS_NOT_NULL,   currentPosition);
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(NullComparisonExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasExpression()) {
      length += length(expression.getExpression()) + SPACE_LENGTH;
    }

    // Within "IS NULL" or "IS NOT NULL"
    if (isPositionWithin(position, length, expression.getIdentifier())) {
      proposals.addIdentifier(IS_NULL);
      proposals.addIdentifier(IS_NOT_NULL);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(NullExpression expression) {
    // No content assist can be provider
    super.visit(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(NullIfExpression expression) {
    super.visit(expression);
    visitCollectionExpression(expression, NULLIF, getDoubleEncapsulatedCollectionHelper());
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(NumericLiteral expression) {
    // No content assist can be provider for a numerical value
    super.visit(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ObjectExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(OrderByClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitCollectionExpression(expression, ORDER_BY, getOrderByClauseCollectionHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(OrderByItem expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // After the order by item
    if (expression.hasExpression()) {
      int length = length(expression.getExpression());

      if (expression.hasSpaceAfterExpression()) {
        length++;

        // Right before "ASC" or "DESC"
        if (position == length) {
          proposals.addIdentifier(ASC);
          proposals.addIdentifier(DESC);
        }
        else {
          // Right after the space
          Ordering ordering = expression.getOrdering();

          // Within "ASC" or "DESC"
          if ((ordering != Ordering.DEFAULT) &&
              isPositionWithin(position, length, ordering.name())) {

            proposals.addIdentifier(ASC);
            proposals.addIdentifier(DESC);
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(OrExpression expression) {
    super.visit(expression);
    visitLogicalExpression(expression, OR);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(RangeVariableDeclaration expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // After "<abstract schema name> "
    if (expression.hasRootObject() &&
        expression.hasSpaceAfterRootObject()) {

      int length = length(expression.getRootObject()) + SPACE_LENGTH;

      // Right after "<abstract schema name> "
      if (isPositionWithin(position, length, AS)) {
        addIdentifier(AS);
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ResultVariable expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasSelectExpression()) {
      length += length(expression.getSelectExpression()) + SPACE_LENGTH;
    }

    // Within "AS"
    if (isPositionWithin(position, length, AS)) {
      addIdentifier(AS);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SelectClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitSelectClause(expression);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SelectStatement expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitSelectStatement(expression, getSelectClauseSelectStatementHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SimpleFromClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitClause(expression, FROM, expression.hasSpaceAfterFrom(), getFromClauseHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SimpleSelectClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitSelectClause(expression);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SimpleSelectStatement expression) {
    if (!isLocked(expression)) {
      // Don't continue traversing the parent hierarchy because a subquery
      // will handle all the possible proposals
      visitSelectStatement(expression, getSimpleSelectClauseSelectStatementHelper());
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SizeExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SqrtExpression expression) {
    expression.accept(visitParentVisitor());
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(StateFieldPathExpression expression) {
    visitPathExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(StringLiteral expression) {
    // No content assist required
    super.visit(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SubExpression expression) {
    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SubstringExpression expression) {
    super.visit(expression);
    visitCollectionExpression(expression, SUBSTRING, getTripleEncapsulatedCollectionHelper());
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SubtractionExpression expression) {
    super.visit(expression);
    visitArithmeticExpression(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(SumFunction expression) {
    super.visit(expression);
    visitAggregateFunction(expression);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(TreatExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - getCorrections().peek();

    // Within "TREAT"
    if (isPositionWithin(position, TREAT)) {
      if (isValidVersion(TREAT)) {
        proposals.addIdentifier(TREAT);
      }
    }
    // After "TREAT("
    else if (expression.hasLeftParenthesis()) {
      int length = TREAT.length() + 1;

      // Right after "TREAT("
      if (position == length) {
        addLeftIdentificationVariables(expression);
      }

      // After "<collection-valued path expression> "
      if (expression.hasCollectionValuedPathExpression() &&
          expression.hasSpaceAfterCollectionValuedPathExpression()) {

        Expression collectionValuedPathExpression = expression.getCollectionValuedPathExpression();
        length += length(collectionValuedPathExpression) + SPACE_LENGTH;

        // Within "AS"
        if (isPositionWithin(position, length, AS)) {
          getProposals().addIdentifier(AS);

          // If the entity type is not specified, then we can add
          // the possible abstract schema names
          if (!expression.hasEntityType()) {

            // If the type of the path expression is resolvable,
            // then filter the abstract schema types
            IType type = getType(collectionValuedPathExpression);

            if (type.isResolvable()) {
              addEntities(type);
            }
            else {
              addEntities();
            }
          }
        }
      }

      // After "AS "
      if (expression.hasAs() &&
          expression.hasSpaceAfterAs()) {

        length += AS.length() + SPACE_LENGTH;

        // Right after "AS "
        if (position == length) {
          // If the type of the path expression is resolvable,
          // then filter the abstract schema types
          IType type = getType(expression.getCollectionValuedPathExpression());

          if (type.isResolvable()) {
            addEntities(type);
          }
          else {
            addEntities();
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(TrimExpression expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    // Within "TRIM"
    if (isPositionWithin(position, TRIM)) {
      proposals.addIdentifier(TRIM);
    }
    // After "TRIM("
    else if (expression.hasLeftParenthesis()) {
      length += TRIM.length() + 1;

      // Right after "TRIM("
      if (position == length) {
        addIdentifier(BOTH);
        addIdentifier(LEADING);
        addIdentifier(TRAILING);

        if (!expression.hasTrimCharacter() &&
            !expression.hasFrom()) {

          addAllIdentificationVariables();
          addAllFunctions(StringPrimaryBNF.ID);
        }
      }

      // Within the trim specification
      if (expression.hasSpecification()) {
        String specification = expression.getSpecification().name();

        if (isPositionWithin(position, length, specification)) {
          addIdentifier(BOTH);
          addIdentifier(LEADING);
          addIdentifier(TRAILING);

          if (!expression.hasTrimCharacter() &&
              !expression.hasFrom()) {

            addAllIdentificationVariables();
            addAllFunctions(StringPrimaryBNF.ID);
          }
        }

        length += specification.length();
      }

      if (expression.hasSpaceAfterSpecification()) {
        length += SPACE_LENGTH;
      }

      // Trim character
      if (expression.hasTrimCharacter()) {
        length += length(expression.getTrimCharacter());
      }

      if (expression.hasSpaceAfterTrimCharacter()) {
        length += SPACE_LENGTH;
      }

      // Right after "<trim_character> "
      if (position == length) {
        addIdentifier(FROM);

        if (!expression.hasFrom()) {
          addAllIdentificationVariables();
          addAllFunctions(StringPrimaryBNF.ID);
        }
      }

      if (expression.hasFrom()) {

        // Within "FROM"
        if (isPositionWithin(position, length, FROM)) {
          addIdentifier(FROM);
        }

        length += FROM.length();
      }

      if (expression.hasSpaceAfterFrom()) {
        length += SPACE_LENGTH;
      }

      // Right after "FROM "
      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(StringPrimaryBNF.ID);
      }

      // Right after the string literal but there is no trim character,
      // nor FROM and there is a virtual space
      if (expression.hasExpression()) {
        length += length(expression.getExpression());

        if ((position == length + virtualSpaces.peek()) &&
            !expression.hasTrimCharacter() &&
            !expression.hasFrom()) {

          addIdentifier(FROM);
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(TypeExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(UnknownExpression expression) {

    corrections.add(getPosition(expression));
    super.visit(expression);
    corrections.pop();

    int position = queryPosition.getPosition();
    String word = this.word;
    this.word = wordParser.substring(position - expression.getLength(), position);

    // Special cases
    addIdentifier(IS_EMPTY,     position);
    addIdentifier(IS_NOT_EMPTY, position);
    addIdentifier(IS_NOT_NULL,  position);
    addIdentifier(IS_NULL,      position);

    this.word = word;
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(UpdateClause expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within "UPDATE"
    if (isPositionWithin(position, UPDATE)) {
      proposals.addIdentifier(UPDATE);
    }
    // After "UPDATE "
    else if (expression.hasSpaceAfterUpdate()) {
      int length = UPDATE.length() + SPACE_LENGTH;

      // Right after "UPDATE "
      if (position == length) {
        addEntities();
      }
      // After "<range variable declaration> "
      else if (expression.hasRangeVariableDeclaration()) {

        RangeVariableDeclaration rangeVariableDeclaration = findRangeVariableDeclaration(expression);

        if ((rangeVariableDeclaration != null) &&
             rangeVariableDeclaration.hasRootObject() &&
             rangeVariableDeclaration.hasSpaceAfterRootObject()) {

          length += length(rangeVariableDeclaration.getRootObject()) + SPACE_LENGTH;

          // Example: "UPDATE System s"
          if (!expression.hasSet()        &&
              !rangeVariableDeclaration.hasAs() &&
              isPositionWithin(position, length, SET)) {

            addIdentifier(SET);
          }
          // Example: "UPDATE System s "
          // Example: "UPDATE System AS s "
          else {

            if (rangeVariableDeclaration.hasAs()) {
              length += 2;
            }

            if (rangeVariableDeclaration.hasSpaceAfterAs()) {
              length++;
            }

            if (rangeVariableDeclaration.hasIdentificationVariable()) {
              length += length(rangeVariableDeclaration.getIdentificationVariable());
            }

            if (expression.hasSpaceAfterRangeVariableDeclaration()) {
              length++;
            }

            // Within "SET"
            if ((rangeVariableDeclaration.hasAs() && rangeVariableDeclaration.hasIdentificationVariable() ||
                !rangeVariableDeclaration.hasAs() && rangeVariableDeclaration.hasIdentificationVariable()) &&
                isPositionWithin(position, length, SET)) {

              addIdentifier(SET);
            }
            // After "SET "
            else if (expression.hasSet() &&
                     expression.hasSpaceAfterSet()) {

              length += SET.length() + SPACE_LENGTH;

              // Right after "SET "
              if (position == length) {
                addAllIdentificationVariables();
              }
              // Within the new value expressions
              else {
                visitCollectionExpression(expression, ExpressionTools.EMPTY_STRING, getUpdateItemCollectionHelper());
              }
            }
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(UpdateItem expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    // At the beginning
    if (position == length) {
      addAllIdentificationVariables();
    }
    else if (expression.hasStateFieldPathExpression() &&
             expression.hasSpaceAfterStateFieldPathExpression()) {

      length += length(expression.getStateFieldPathExpression()) + SPACE_LENGTH;

      // Within "="
      if (position == length) {
        proposals.addIdentifier(EQUAL);
      }
      // After "="
      else if (expression.hasEqualSign()) {
        length++;

        // Right after "="
        if (position == length) {
          proposals.addIdentifier(EQUAL);
          addAllIdentificationVariables();
          addAllFunctions(NewValueBNF.ID);
        }
        else if (expression.hasSpaceAfterEqualSign()) {
          length++;

          // Right after "= "
          if (position == length) {
            addAllIdentificationVariables();
            addAllFunctions(NewValueBNF.ID);
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(UpdateStatement expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitUpdateStatement(expression);
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(UpperExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.ALL);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(ValueExpression expression) {
    super.visit(expression);
    visitSingleEncapsulatedExpression(expression, IdentificationVariableType.LEFT_COLLECTION);
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(WhenClause expression) {
    super.visit(expression);
    int position = getPosition(expression) - corrections.peek();

    // Within "WHEN"
    if (isPositionWithin(position, WHEN)) {
      proposals.addIdentifier(WHEN);
    }
    // After "WHEN "
    else if (expression.hasSpaceAfterWhen()) {
      int length = WHEN.length() + SPACE_LENGTH;

      // Right after "WHEN "
      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(InternalWhenClauseBNF.ID);
      }
      else {
        length += length(expression.getWhenExpression());

        // After "WHEN <expression> " => THEN
        if (expression.hasSpaceAfterWhenExpression()) {
          length++;

          // Right after "WHEN <expression> " => THEN
          if (position == length) {
            proposals.addIdentifier(THEN);
          }
          else if (expression.hasThen()) {
            // Within "THEN"
            if (isPositionWithin(position, length, THEN)) {
              proposals.addIdentifier(THEN);
            }
            else {
              length += THEN.length();

              // After "WHEN <expression> THEN "
              if (expression.hasSpaceAfterThen()) {
                length++;

                // Right after "WHEN <expression> THEN "
                if (position == length) {
                  addScalarExpressionProposals();
                }
              }
            }
          }
        }
      }
    }
  }

  /**
   * {@inheritDoc}
   */
  @Override
  public void visit(WhereClause expression) {
    if (!isLocked(expression)) {
      super.visit(expression);
      visitClause(expression, WHERE, expression.hasSpaceAfterIdentifier(), whereClauseHelper());
      visitCompoundableExpression(expression);
    }
  }

  protected void visitAggregateFunction(AggregateFunction expression) {

    int position = getPosition(expression) - corrections.peek();
    String identifier = expression.getIdentifier();

    // Within "<identifier>"
    if (isPositionWithin(position, identifier)) {
      proposals.addIdentifier(identifier);
    }
    // After "<identifier>("
    else if (expression.hasLeftParenthesis()) {
      int length = identifier.length() + 1 /* '(' */;
      boolean hasDistinct = expression.hasDistinct();

      // Within "DISTINCT"
      if (hasDistinct && isPositionWithin(position, length, DISTINCT) ) {
        addIdentifier(DISTINCT);
      }
      // After "("
      else {
        if (hasDistinct && expression.hasSpaceAfterDistinct()) {
          length += DISTINCT.length() + SPACE_LENGTH;
        }

        // Right after "(" or right after "(DISTINCT "
        if (position == length) {
          if (!hasDistinct) {
            addIdentifier(DISTINCT);
          }
          addAllIdentificationVariables();
          addAllFunctions(expression.encapsulatedExpressionBNF());
        }
      }
    }
  }

  protected void visitArithmeticExpression(ArithmeticExpression expression) {

    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasLeftExpression()) {
      length += length(expression.getLeftExpression()) + SPACE_LENGTH;
    }

    // Within the arithmetic sign
    if (isPositionWithin(position, length, PLUS)) {
      addAllAggregates(expression.getQueryBNF());
    }
    // After the arithmetic sign, with or without the space
    else if (expression.hasSpaceAfterIdentifier()) {
      length += 2;

      // Right after the space
      if ((position == length) && (positionInCollections.peek() == -1)) {
        addAllIdentificationVariables();
        addAllFunctions(expression.rightExpressionBNF(), position);
      }
    }
  }

  protected <T extends AbstractExpression> void visitClause(T expression,
                                                            String identifier,
                                                            boolean hasSpaceAfterIdentifier,
                                                            ClauseHelper<T> helper) {

    lockedExpressions.add(expression);
    int correction = corrections.peek();
    int position = getPosition(expression) - correction;

    // Within "<identifier>"
    if (isPositionWithin(position, identifier)) {
      proposals.addIdentifier(identifier);
    }
    // After "<identifier> "
    else if (hasSpaceAfterIdentifier) {
      int length = identifier.length() + SPACE_LENGTH;

      // Right after "<identifier> "
      if (position == length) {
        helper.addProposals(expression);
      }
      // Somewhere in the clause's expression
      else {
        Expression clauseExpression = helper.getClauseExpression(expression);
        int clauseExpressionLength = length(clauseExpression);

        // At the end of the clause's expression
        if (position == length + clauseExpressionLength + virtualSpaces.peek()) {

          virtualSpaces.add(SPACE_LENGTH);
          corrections.add(-clauseExpressionLength - 2);

          clauseExpression.accept(this);

          // Now ask the helper to add possible identifiers at the end of its expression
          if (isComplete(clauseExpression)) {
            helper.addAtTheEndOfExpression(expression);
          }

          virtualSpaces.pop();
          corrections.pop();
        }
        // At the end of the clause's expression, check to see if the identifier can be appended
        else if (position == length + clauseExpressionLength + virtualSpaces.peek() - correction) {

          // Now ask the helper to add possible identifiers at the end of its expression
          if (isAppendable(clauseExpression)) {
            helper.addAtTheEndOfExpression(expression);
          }
        }
      }
    }

    lockedExpressions.pop();
  }

  /**
   * Adds the possible proposals for the given {@link Expression expression} based on the location of
   * the cursor and the content of the expression.
   *
   * @param expression The {@link Expression expression} being visited
   * @param identifier
   * @param helper
   */
  protected <T extends Expression> void visitCollectionExpression(T expression,
                                                                  String identifier,
                                                                  CollectionExpressionHelper<T> helper) {

    int position = getPosition(expression) - corrections.peek();

    // Within the identifier
    if (isPositionWithin(position, identifier)) {
      proposals.addIdentifier(identifier);
    }
    // After "<identifier>(" or "<identifier> "
    else if (helper.hasDelimiterAfterIdentifier(expression)) {
      int length = identifier.length() + 1 /* delimiter, either space or ( */;
      length += helper.preExpressionLength(expression);

      // Right after "<identifier>(" or "<identifier> "
      if (position == length) {
        helper.addProposals(expression, 0);
      }
      // Within the encapsulated expressions
      else {
        // Create a collection representation of the encapsulated expression(s)
        CollectionExpression collectionExpression = helper.buildCollectionExpression(expression);
        boolean hasComma = false;

        // Determine the maximum children count, it is possible the query contains more children
        // than the expession's grammar would actually allow. The content assist will only
        // provide assistance from the first child to the last allowed child
        int count = Math.min(collectionExpression.childrenSize(), helper.maxCollectionSize(expression));

        for (int index = 0; index < count; index++) {
          Expression child = collectionExpression.getChild(index);
          int childLength = 0;

          // At the beginning of the child expression
          if (position == length) {
            helper.addProposals(expression, index);
            break;
          }
          else {
            childLength = length(child);

            // At the end of the child expression
            if ((position == length + childLength + virtualSpaces.peek()) &&
                 isComplete(child)) {

              helper.addAtTheEndOfChild(expression, child, index);
              break;
            }
          }

          // Now add the child's length and length used by the comma and space
          length += childLength;

          // Move after the comma
          hasComma = collectionExpression.hasComma(index);

          if (hasComma) {
            length++;

            // After ',', the proposals can be added
            if (position == length) {
              helper.addProposals(expression, index + 1);
              break;
            }
          }

          // Move after the space that follows the comma
          if (collectionExpression.hasSpace(index)) {
            length++;
          }

          // Nothing more can be looked at
          if (position < length) {
            break;
          }
        }
      }
    }
  }

  protected void visitCompoundableExpression(AbstractConditionalClause expression) {

    if (expression.hasConditionalExpression()) {

      // Get the position and start length
      int position = getPosition(expression);
      int length = expression.getIdentifier().length() + SPACE_LENGTH;

      CompoundExpressionHelper helper = getCompoundExpressionHelper();

      try {
        // Start scanning the conditional expression
        expression.getConditionalExpression().accept(helper);

        // Visit the conditional expression in order to determine if identifiers defined has
        // compound (example: BETWEEN) can be added as possible proposals
        visitCompoundableExpression(helper, position, length);
      }
      finally {
        helper.dispose();
      }
    }
  }

  protected void visitCompoundableExpression(CompoundExpressionHelper helper,
                                             int position,
                                             int length) {

    length += helper.length();

    // At the end of an expression
    if (position == length) {
      if (helper.isCompoundable()) {
        addAllCompounds(ConditionalExpressionBNF.ID);
      }
    }
    // Continue inside of the conditional expression
    else if (helper.hasIdentifier()) {
      length += helper.identifierLength();

      if (helper.hasNext()) {
        helper.next();
        visitCompoundableExpression(helper, position, length);
      }
    }
  }

  protected void visitDeleteStatement(DeleteStatement expression) {

    lockedExpressions.add(expression);
    int position = getPosition(expression) - corrections.peek();

    //
    // DELETE clause
    //
    DeleteClause deleteClause = expression.getDeleteClause();
    int length = length(deleteClause);

    // At the end of the DELETE clause, check for adding proposals based
    // on possible incomplete information
    if ((position == length) && isAppendable(deleteClause)) {
      addIdentifier(WHERE);
    }
    // Right after the DELETE clause, the space is owned by JPQLExpression
    else if ((position == length + SPACE_LENGTH) && expression.hasSpaceAfterDeleteClause()) {

      virtualSpaces.add(SPACE_LENGTH);
      corrections.add(-length - 2);

      deleteClause.accept(this);

      corrections.pop();
      virtualSpaces.pop();
    }

    // Nothing else to do
    if ((position == length) && !expression.hasSpaceAfterDeleteClause()) {
      return;
    }

    if (expression.hasSpaceAfterDeleteClause()) {
      length++;
    }

    // Nothing else to do
    if ((position == length) && !deleteClause.hasRangeVariableDeclaration()) {
      return;
    }

    //
    // WHERE clause
    //
    // Right before "WHERE"
    if (position == length) {

      if (expression.hasSpaceAfterDeleteClause() &&
          isComplete(deleteClause.getRangeVariableDeclaration())) {

        addIdentifier(WHERE);
      }
    }

    if (expression.hasWhereClause()) {
      AbstractConditionalClause whereClause = (AbstractConditionalClause) expression.getWhereClause();

      // Check for within the WHERE clause
      if (position > length) {
        int whereClauseLength = length(whereClause);
        length += whereClauseLength;

        // Right after the WHERE clause
        if (position == length + SPACE_LENGTH) {

          virtualSpaces.add(SPACE_LENGTH);
          corrections.add(-whereClauseLength - 2);

          whereClause.accept(this);

          corrections.pop();
          virtualSpaces.pop();
        }
      }
    }
  }

  /**
   * Adds the possible proposals for the given {@link AbstractEncapsulatedExpression expression}
   * based on the location of the cursor and the content of the expression.
   *
   * @param expression The {@link AbstractEncapsulatedExpression expression} being visited
   * @param identifier
   * @param jpqlQueryBNF
   */
  protected void visitEncapsulatedExpression(AbstractEncapsulatedExpression expression,
                                             String identifier,
                                             String jpqlQueryBNF) {

    int position = getPosition(expression) - corrections.peek();

    // Within the identifier
    if (isPositionWithin(position, identifier)) {
      proposals.addIdentifier(identifier);
    }
    // Right after "<identifier>("
    else if (expression.hasLeftParenthesis()) {
      int length = identifier.length() + 1 /* '(' */;

      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(jpqlQueryBNF);
      }
    }
  }

  protected void visitLogicalExpression(LogicalExpression expression, String identifier) {

    int position = getPosition(expression) - corrections.peek();
    int length = 0;

    if (expression.hasLeftExpression()) {
      length += length(expression.getLeftExpression()) + SPACE_LENGTH;
    }

    // Within "AND" or "OR"
    if (isPositionWithin(position, length, expression.getIdentifier())) {
      proposals.addIdentifier(identifier);
    }
    // After "AND " or "OR "
    else if (expression.hasSpaceAfterIdentifier()) {
      length += identifier.length() + SPACE_LENGTH;

      // Right after "AND " or "OR "
      if (position == length) {
        addAllIdentificationVariables();
        addAllFunctions(expression.rightExpressionBNF());
      }
    }
  }

  protected VisitParentVisitor visitParentVisitor() {
    VisitParentVisitor helper = getHelper(VisitParentVisitor.class);
    if (helper == null) {
      helper = buildVisitParentVisitor();
      registerHelper(VisitParentVisitor.class, helper);
    }
    return helper;
  }

  protected void visitPathExpression(AbstractPathExpression expression) {

    int position = getPosition(expression);
    String text = expression.toActualText();
    int dotIndex = text.indexOf(AbstractExpression.DOT);

    if (position > -1) {
      if ((dotIndex > -1) && (position > dotIndex)) {
        // Retrieve the filter based on the location of the state field path, for instance, in a
        // JOIN or IN expression, the filter has to filter out the property and accept the fields
        // of collection type
        visitPathExpression(expression, buildMappingFilter(expression));
      }
      else {
        String variableName = context.literal(
          expression.getIdentificationVariable(),
          LiteralType.IDENTIFICATION_VARIABLE
        );

        // Don't do anything if the identification variable is either KEY() or VALUE()
        if (ExpressionTools.stringIsNotEmpty(variableName)) {
          corrections.add(getPosition(expression));
          visit(expression);
          corrections.pop();
        }
      }
    }
  }

  protected void visitPathExpression(AbstractPathExpression expression, Filter<IMapping> helper) {

    MappingCollector mappingCollector = getDefaultMappingCollector();
    int position = queryPosition.getPosition(expression);
    boolean mappingCollectorCreated = false;
    Resolver resolver = null;
    int length = 0;

    for (int index = 0, count = expression.pathSize(); index < count; index++) {
      String path = expression.getPath(index);

      // We're at the position, create the ChoiceBuilder
      if (position <= length + path.length()) {

        if (length == position) {
          path = ExpressionTools.EMPTY_STRING;
        }
        else if (position - length > -1) {
          path = path.substring(0, position - length);
        }

        // Special case where the path expression only has the
        // identification variable set
        if (resolver == null) {
          break;
        }

        mappingCollector = buildFilteringMappingCollector(expression, resolver, helper, path);
        mappingCollectorCreated = true;
        break;
      }
      // The path is entirely before the position of the cursor
      else {
        // The first path is always an identification variable
        if (resolver == null) {
          resolver = context.getResolver(expression.getIdentificationVariable());
        }
        // Any other path is a property or collection-valued path
        else if ((index + 1 < count) || expression.endsWithDot()) {
          Resolver childResolver = resolver.getChild(path);
          if (childResolver == null) {
            childResolver = new StateFieldResolver(resolver, path);
            resolver.addChild(path, childResolver);
            resolver = childResolver;
          }
        }

        // Move the cursor after the path and dot
        length += path.length() + 1;
      }
    }

    if (!mappingCollectorCreated && (resolver != null)) {
      mappingCollector = buildMappingCollector(expression, resolver, helper);
    }

    proposals.addMappings(mappingCollector.buildProposals());
  }

  protected void visitSelectClause(AbstractSelectClause expression) {

    int position = getPosition(expression) - corrections.peek();

    // Within "SELECT"
    if (isPositionWithin(position, SELECT)) {
      proposals.addIdentifier(SELECT);
    }
    // After "SELECT "
    else if (expression.hasSpaceAfterSelect()) {
      int length = SELECT.length() + SPACE_LENGTH;

      // Within "DISTINCT"
      if (expression.hasDistinct() &&
          isPositionWithin(position, length, DISTINCT)) {

        proposals.addIdentifier(DISTINCT);
      }
      // After "DISTINCT "
      else {
        if (expression.hasDistinct()) {
          length += DISTINCT.length();

          if (expression.hasSpaceAfterDistinct()) {
            length++;
          }
        }

        // Right after "SELECT " or after "DISTINCT "
        if (position == length) {
          if (!expression.hasDistinct()) {
            addIdentifier(DISTINCT);
          }
          addAllIdentificationVariables();
          addAllFunctions(expression.selectItemBNF());
        }
        // Somewhere in the clause's expression
        else {
          int selectExpressionLength = length(expression.getSelectExpression());

          // At the end of the clause's expression
          if (position <= length + selectExpressionLength + virtualSpaces.peek()) {
            addSelectExpressionProposals(expression, length);
          }
        }
      }
    }
  }

  protected SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression>
          visitSelectStatement(AbstractSelectStatement expression,
                               int position,
                               int[] length,
                               SelectStatementHelper<AbstractSelectStatement, Expression> helper) {

    // Right before the identifier
    if (position == length[0]) {

      if (helper.hasSpaceBeforeClause(expression) &&
          isPreviousClauseComplete(expression, helper)) {

        helper.addClauseProposal();
      }

      return null;
    }

    if (helper.hasClause(expression)) {
      Expression clause = helper.getClause(expression);

      // Check for within the clause
      if (position > length[0]) {
        int clauseLength = length(clause);
        length[0] += clauseLength;
        boolean hasSpaceAfterIdentifier = helper.hasSpaceAfterClause(expression);
        Expression clauseExpression = helper.getClauseExpression(clause);

        // At the end of the clause, check for adding proposals based
        // on possible incomplete information
        if (position == length[0]) {
          helper.appendNextClauseProposals(expression, clause, position, false);
        }
        // Right after the clause, the space is owned by the select statement
        else if ((position == length[0] + SPACE_LENGTH) && hasSpaceAfterIdentifier) {

          virtualSpaces.add(SPACE_LENGTH);
          corrections.add(-clauseLength - 2);

          clause.accept(this);

          corrections.pop();
          virtualSpaces.pop();

          // Now add the following clause identifiers
          if (helper.isClauseExpressionComplete(clauseExpression)) {
            helper.appendNextClauseProposals(expression, clause, position, true);
          }
        }

        // Nothing else to do
        if ((position < length[0]) || (position == length[0]) && !hasSpaceAfterIdentifier) {
          return null;
        }

        if (hasSpaceAfterIdentifier) {
          length[0]++;
        }

        // Nothing else to do
        if ((position < length[0]) || (position == length[0]) && !helper.hasClauseExpression(clause)) {
          return null;
        }

        // Right before the next clause
        if (position == length[0]) {

          if (hasSpaceAfterIdentifier && helper.isClauseExpressionComplete(clauseExpression)) {
            helper.appendNextClauseProposals(expression, clause, position, true);
          }

          return null;
        }
      }
    }

    return helper.getNextHelper();
  }

  protected void visitSelectStatement(AbstractSelectStatement expression,
                                      SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression> helper) {

    lockedExpressions.add(expression);

    try {
      int position = getPosition(expression);
      int[] length = new int[1];

      while (helper != null) {
        helper = visitSelectStatement(expression, position, length, cast(helper));
      }
    }
    finally {
      lockedExpressions.pop();
    }
  }

  /**
   * Adds the possible proposals for the given {@link AbstractSingleEncapsulatedExpression expression}
   * based on the location of the cursor and the content of the expression.
   *
   * @param expression The {@link AbstractSingleEncapsulatedExpression expression} being visited
   * @param identificationVariableType The type of identification variables that can be added as
   * possible proposals
   */
  protected void visitSingleEncapsulatedExpression(AbstractSingleEncapsulatedExpression expression,
                                                   IdentificationVariableType identificationVariableType) {

    visitSingleEncapsulatedExpression(
      expression,
      identificationVariableType,
      expression.getIdentifier()
    );
  }

  /**
   * Adds the possible proposals for the given {@link AbstractSingleEncapsulatedExpression expression}
   * based on the location of the cursor and the content of the expression.
   *
   * @param expression The {@link AbstractSingleEncapsulatedExpression expression} being visited
   * @param identificationVariableType The type of identification variables that can be added as
   * possible proposals
   * @param expressionIdentifiers Sometimes the expression may have more than one possible identifier,
   * such as <b>ALL</b>, <b>ANY</b> and <b>SOME</b> are a possible JPQL identifier for a single
   * expression ({@link AllOrAnyExpression}
   */
  protected void visitSingleEncapsulatedExpression(AbstractSingleEncapsulatedExpression expression,
                                                   IdentificationVariableType identificationVariableType,
                                                   String... expressionIdentifiers) {

    int position = getPosition(expression) - corrections.peek();
    String actualIdentifier = expression.getIdentifier();
    boolean added = false;

    for (String identifier : expressionIdentifiers) {

      // Within the identifier
      if (isPositionWithin(position, actualIdentifier)) {
        proposals.addIdentifier(identifier);
      }
      // Right after "<identifier>("
      else if (expression.hasLeftParenthesis()) {
        int length = identifier.length() + 1 /* '(' */;

        if (!added && (position == length)) {
          added = true;

          addIdentificationVariables(identificationVariableType, expression);

          String queryBNF = expression.encapsulatedExpressionBNF();
          addAllFunctions(queryBNF);
          addAllClauses(queryBNF);
        }
      }
    }
  }

  protected void visitUpdateStatement(UpdateStatement expression) {

    lockedExpressions.add(expression);
    int position = getPosition(expression);

    //
    // UPDATE clause
    //
    UpdateClause updateClause = expression.getUpdateClause();
    int length = length(updateClause);

    // Right after the UPDATE clause, the space is owned by the select statement
    if ((position == length + SPACE_LENGTH) && expression.hasSpaceAfterUpdateClause()) {

      virtualSpaces.add(SPACE_LENGTH);
      corrections.add(-length - 2);

      updateClause.accept(this);

      corrections.pop();
      virtualSpaces.pop();
    }

    // Nothing else to do
    if ((position == length) && !expression.hasSpaceAfterUpdateClause()) {
      return;
    }

    if (expression.hasSpaceAfterUpdateClause()) {
      length++;
    }

    // Nothing else to do
    if ((position == length) && !updateClause.hasRangeVariableDeclaration()) {
      return;
    }

    //
    // WHERE clause
    //
    // Right before "WHERE"
    if (position == length) {

      if (expression.hasSpaceAfterUpdateClause() &&
          isComplete(updateClause.getUpdateItems())) {

        addIdentifier(WHERE);
      }

      return;
    }

    if (expression.hasWhereClause()) {
      AbstractConditionalClause whereClause = (AbstractConditionalClause) expression.getWhereClause();

      // Check for within the WHERE clause
      if (position > length) {
        int whereClauseLength = length(whereClause);
        length += whereClauseLength;

        // Right after the WHERE clause, the space is owned by the select statement
        if (position == length + SPACE_LENGTH) {

          virtualSpaces.add(SPACE_LENGTH);
          corrections.add(-whereClauseLength - 2);

          whereClause.accept(this);

          corrections.pop();
          virtualSpaces.pop();
        }
      }
    }
  }

  protected ClauseHelper<WhereClause> whereClauseHelper() {
    WhereClauseHelper helper = getHelper(WhereClauseHelper.class);
    if (helper == null) {
      helper = buildWhereClauseHelper();
      registerHelper(WhereClauseHelper.class, helper);
    }
    return helper;
  }

  protected WhereClauseSelectStatementHelper whereClauseSelectStatementHelper() {
    WhereClauseSelectStatementHelper helper = getHelper(WhereClauseSelectStatementHelper.class);
    if (helper == null) {
      helper = buildWhereClauseSelectStatementHelper();
      registerHelper(WhereClauseSelectStatementHelper.class, helper);
    }
    return helper;
  }

  protected abstract class AbstractFromClauseSelectStatementHelper<T extends AbstractSelectStatement>
                     implements SelectStatementHelper<T, AbstractFromClause> {

    protected boolean addAppendableToCollection(T expression, int position) {

      if (wordParser.endsWith(position, "GROUP") ||
          wordParser.endsWith(position, "GROUP B")) {

        if (!expression.hasWhereClause()) {
          proposals.addIdentifier(GROUP_BY);
        }

        return true;
      }
      else if (wordParser.endsWith(position, "ORDER") ||
               wordParser.endsWith(position, "ORDER B")) {

        if (!expression.hasWhereClause() &&
           !expression.hasHavingClause()) {

          proposals.addIdentifier(ORDER_BY);
        }

        return true;
      }

      return false;
    }

    /**
     * Requests this helper to add the JPQL identifiers for the clauses that follows the <b>FROM</b>
     * clause.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     */
    protected abstract void addClauseIdentifierProposals(T expression);

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(FROM);
    }

    /**
     * {@inheritDoc}
     */
    public final void appendNextClauseProposals(T expression,
                                                AbstractFromClause clause,
                                                int position,
                                                boolean complete) {

      if (complete || isAppendable(clause)) {
        addClauseIdentifierProposals(expression);
      }
      else if (isAppendableToCollection(clause)) {
        boolean skip = addAppendableToCollection(expression, position);

        if (!skip) {
          addClauseIdentifierProposals(expression);
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public AbstractFromClause getClause(T expression) {
      return (AbstractFromClause) expression.getFromClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(AbstractFromClause clause) {
      return clause.getDeclaration();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(AbstractSelectStatement expression) {
      return expression.hasFromClause();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(AbstractFromClause clause) {
      return clause.hasDeclaration();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(T expression) {
      return expression.hasSpaceAfterFrom();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(T expression) {
      return expression.hasSpaceAfterSelect();
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return isComplete(expression);
    }
  }

  protected abstract class AbstractGroupByClauseSelectStatementHelper<T extends AbstractSelectStatement>
                     implements SelectStatementHelper<T, GroupByClause> {

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(GROUP_BY);
    }

    /**
     * {@inheritDoc}
     */
    public GroupByClause getClause(AbstractSelectStatement expression) {
      return (GroupByClause) expression.getGroupByClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(GroupByClause clause) {
      return clause.getGroupByItems();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(AbstractSelectStatement expression) {
      return expression.hasGroupByClause();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(GroupByClause clause) {
      return clause.hasGroupByItems();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterGroupBy();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterWhere();
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return isGroupByComplete(expression);
    }
  }

  protected abstract class AbstractHavingClauseSelectStatementHelper<T extends AbstractSelectStatement>
                     implements SelectStatementHelper<T, HavingClause> {

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(HAVING);
    }

    /**
     * {@inheritDoc}
     */
    public HavingClause getClause(AbstractSelectStatement expression) {
      return (HavingClause) expression.getHavingClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(HavingClause clause) {
      return clause.getConditionalExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(AbstractSelectStatement expression) {
      return expression.hasHavingClause();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(HavingClause clause) {
      return clause.hasConditionalExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterGroupBy();
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return isConditionalExpressionComplete(expression);
    }
  }

  protected abstract class AbstractSelectClauseSelectStatementHelper
                     implements SelectStatementHelper<AbstractSelectStatement, AbstractSelectClause> {

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(SELECT);
    }

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(AbstractSelectStatement expression,
                                          AbstractSelectClause clause,
                                          int position,
                                          boolean complete) {

      if (complete || isAppendable(clause)) {
        addIdentifier(FROM);
      }
    }

    /**
     * {@inheritDoc}
     */
    public AbstractSelectClause getClause(AbstractSelectStatement expression) {
      return expression.getSelectClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(AbstractSelectClause clause) {
      return clause.getSelectExpression();
    }

    /**
     * {@inheritDoc}
     */
    public SelectStatementHelper<AbstractSelectStatement, Expression> getPreviousHelper() {
      return null;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(AbstractSelectStatement expression) {
      return true;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(AbstractSelectClause clause) {
      return clause.hasSelectExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterSelect();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(AbstractSelectStatement expression) {
      return false;
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return isSelectExpressionComplete(expression);
    }
  }

  protected abstract class AbstractWhereClauseSelectStatementHelper<T extends AbstractSelectStatement>
                     implements SelectStatementHelper<T, WhereClause> {

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(WHERE);
    }

    /**
     * {@inheritDoc}
     */
    public WhereClause getClause(AbstractSelectStatement expression) {
      return (WhereClause) expression.getWhereClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(WhereClause clause) {
      return clause.getConditionalExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(AbstractSelectStatement expression) {
      return expression.hasWhereClause();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(WhereClause clause) {
      return clause.hasConditionalExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterWhere();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(AbstractSelectStatement expression) {
      return expression.hasSpaceAfterFrom();
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return isConditionalExpressionComplete(expression);
    }
  }

  /**
   * This visitor retrieves the permitted type from the path expression's parent. For instance,
   * <b>SUM<b></b> or <b>AVG</b> only accepts state fields that have a numeric type.
   */
  protected class AcceptableTypeVisitor extends AbstractExpressionVisitor {

    /**
     * The type that is retrieved based on the expression, it determines what is acceptable.
     */
    IType type;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AbsExpression expression) {
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ArithmeticFactor expression) {
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AvgFunction expression) {
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {
      expression.getParent().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ConcatExpression expression) {
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LengthExpression expression) {
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LocateExpression expression) {
      // TODO: Handle the position
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LowerExpression expression) {
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ModExpression expression) {
      // In theory we would only allow Long and Integer
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SqrtExpression expression) {
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubExpression expression) {
      expression.getParent().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubstringExpression expression) {
      // TODO: Handle the position
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SumFunction expression) {
      type = getType(Number.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TrimExpression expression) {
      type = getType(CharSequence.class);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(UpperExpression expression) {
      type = getType(CharSequence.class);
    }
  }

  /**
   * This visitor scans the visited {@link Expression} and determines if a JPQL identifier can be
   * added when the position is at the end of a clause and the ending of the clause can be seen as
   * the beginning of an identifier.
   * <p>
   * For instance, in "<code>SELECT e, AVG(e.age) F</code>", F is parsed as a result variable but
   * can also be seen as the first letter for <b>FROM</b>.
   */
  protected class AppendableExpressionVisitor extends AbstractTraverseChildrenVisitor {

    /**
     *
     */
    protected boolean appendable;

    /**
     *
     */
    protected boolean clauseOfItems;

    /**
     *
     */
    protected boolean hasComma;

    /**
     *
     */
    protected int positionInCollection;

    /**
     * Creates a new <code>AppendableExpressionVisitor</code>.
     */
    AppendableExpressionVisitor() {
      super();
      this.positionInCollection = -1;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AdditionExpression expression) {
      super.visit(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AndExpression expression) {
      super.visit(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {

      positionInCollection = expression.childrenSize() - 1;
      hasComma = expression.hasComma(positionInCollection - 1);

      try {
        expression.accept(positionInCollection, this);
      }
      finally {
        hasComma = false;
        positionInCollection = -1;
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(DivisionExpression expression) {
      super.visit(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(GroupByClause expression) {
      clauseOfItems = true;
      super.visit(expression);
      clauseOfItems = false;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariable expression) {
      if (clauseOfItems) {
        appendable = (positionInCollection > -1) && !hasComma;
      }
      else {
        appendable = (positionInCollection > -1);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariableDeclaration expression) {

      // 1) The FROM clause needs to have more than one identification variable declaration
      //    before the next clauses identifiers can be added. Example: "SELECT e FROM E" where
      //    'E' cannot be the beginning of a clause identifier
      // 2) The next clauses identifiers cannot be added if there is a comma before the last
      //    item. Example: "SELECT e FROM Employee e, I" where 'I' cannot be the beginning of
      //    a clause identifier
      if ((positionInCollection == -1) || hasComma) {
        appendable = false;
      }
      else if (expression.hasJoins()) {
        expression.getJoins().accept(this);
      }
      else {
        expression.getRangeVariableDeclaration().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MultiplicationExpression expression) {
      super.visit(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrderByClause expression) {
      clauseOfItems = true;
      super.visit(expression);
      clauseOfItems = false;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrderByItem expression) {
      appendable = expression.hasSpaceAfterExpression() &&
                   expression.isDefault() ||
                   expression.hasSpaceAfterOrdering() &&
                   (!expression.isNullsFirst() && !expression.isNullsLast());
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrExpression expression) {
      super.visit(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(RangeVariableDeclaration expression) {
      // Only the abstract schema name is parsed
      appendable = !expression.hasSpaceAfterRootObject() &&
                   !expression.hasAs() &&
                   !expression.hasIdentificationVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ResultVariable expression) {
      // The result variable is parsed without AS
      appendable = !expression.hasAs() &&
                   !expression.hasSpaceAfterAs() &&
                    expression.hasResultVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubtractionExpression expression) {
      super.visit(expression);
    }
  }

  /**
   * This helper is responsible to add the proposals
   */
  protected interface ClauseHelper<T extends Expression> {

    /**
     * Adds the proposals because the cursor is at the end of the {@link Expression}.
     *
     * @param expression The clause for which proposals can be added after the expression
     */
    void addAtTheEndOfExpression(T expression);

    /**
     * Adds the possible proposals.
     *
     * @param expression The clause for which proposals can be added
     */
    void addProposals(T expression);

    /**
     * Returns the expression from the given clause.
     *
     * @param expression The clause for which its expression is needed
     * @return The clause's expression
     */
    Expression getClauseExpression(T expression);
  }

  /**
   *
   */
  protected interface CollectionExpressionHelper<T extends Expression> {

    /**
     * Adds the proposals because the cursor is at the end of the given child {@link Expression}.
     *
     * @param expression The {@link Expression} being visited
     * @param child The child of the parent {@link Expression} for which proposals can be added
     * at the end
     * @param index The position of that child in the collection of children
     */
    void addAtTheEndOfChild(T expression, Expression child, int index);

    /**
     * Adds
     *
     * @param expression
     * @param index
     */
    void addProposals(T expression, int index);

    /**
     * Either returns the given {@link Expression}'s child, which is already a {@link CollectionExpression}
     * or requests this helper to return a "virtual" {@link CollectionExpression} that is wrapping
     * the single element.
     *
     * @param expression The parent of the children to retrieve
     * @return The given expression's child or a "virtual" one
     */
    CollectionExpression buildCollectionExpression(T expression);

    /**
     * Determines whether
     *
     * @param expression
     * @return
     */
    boolean hasDelimiterAfterIdentifier(T expression);

    /**
     * Returns the maximum number of encapsulated {@link Expression expressions} the {@link
     * Expression} allows. Some expression only allow 2, others 3 and others allow an unlimited
     * number.
     *
     * @param expression The {@link Expression} for which its maximum number of children
     * @return The maximum number of children the expression can have
     */
    int maxCollectionSize(T expression);

    /**
     * Returns the length to add to
     */
    int preExpressionLength(T expression);

    /**
     * Returns the
     *
     * @param expression
     * @return
     */
    JPQLQueryBNF queryBNF(T expression, int index);
  }

  /**
   * This visitor retrieves the {@link CollectionExpression} if it is visited.
   */
  protected static class CollectionExpressionVisitor extends AbstractExpressionVisitor {

    /**
     * The {@link CollectionExpression} if it is the {@link Expression} that was visited.
     */
    protected CollectionExpression expression;

    /**
     * Creates a new <code>CollectionExpressionVisitor</code>.
     */
    protected CollectionExpressionVisitor() {
      super();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {
      this.expression = expression;
    }
  }

  protected class CollectionMappingFilter implements Filter<IMapping> {

    /**
     * {@inheritDoc}
     */
    public boolean accept(IMapping value) {
      // Both association and collection field are accepted
      // Example: e.address is incomplete but it is not the entire path
      // Example: e.projects is the complete path
      return value.isRelationship();
    }
  }

  protected abstract class CompletenessVisitor extends AbstractExpressionVisitor {

    /**
     * Determines whether an {@link Expression} that was visited is complete or if some part is missing.
     */
    protected boolean complete;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {
      int lastIndex = expression.childrenSize() - 1;
      AbstractExpression child = (AbstractExpression) expression.getChild(lastIndex);
      child.accept(this);
    }
  }

  /**
   * This helper is responsible to traverse the parsed tree and to determine if JPQL identifiers
   * with a compound role can be appended after an {@link Expression}, which is based on the
   * location of the cursor.
   */
  protected class CompoundExpressionHelper extends AnonymousExpressionVisitor {

    protected Expression leftExpression;
    protected LogicalExpression logicalExpression;
    protected Expression rightExpression;

    void dispose() {
      leftExpression    = null;
      rightExpression   = null;
      logicalExpression = null;
    }

    boolean hasIdentifier() {
      if (logicalExpression != null) {
        return true;
      }
      return false;
    }

    boolean hasNext() {
      return rightExpression != null;
    }

    int identifierLength() {
      if (logicalExpression != null) {
        int length = logicalExpression.getIdentifier().length();
        length += logicalExpression.hasLeftExpression()       ? 1 : 0;
        length += logicalExpression.hasSpaceAfterIdentifier() ? 1 : 0;
        return length;
      }
      return 0;
    }

    boolean isCompoundable() {
      return isComplete(leftExpression);
    }

    int length() {
      if (leftExpression != null) {
        return AbstractContentAssistVisitor.this.length(leftExpression);
      }
      return 0;
    }

    void next() {
      rightExpression.accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AndExpression expression) {
      visitLogicalExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(Expression expression) {
      this.leftExpression = expression;
      this.rightExpression = null;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrExpression expression) {
      visitLogicalExpression(expression);
    }

    protected void visitLogicalExpression(LogicalExpression expression) {

      this.logicalExpression = expression;

      if (expression.hasLeftExpression()) {
        this.leftExpression = expression.getLeftExpression();
      }
      else {
        this.leftExpression = null;
      }

      if (expression.hasRightExpression()) {
        this.rightExpression = expression.getRightExpression();
      }
      else {
        this.rightExpression = null;
      }
    }
  }

  /**
   * This visitor checks to see if the conditional expression is complete or not. To be complete,
   * the expression's ending has to be complete.
   * <p>
   * For instance:<br>
   * "<code>WHERE e.name</code>" is not complete because <code>e.name</code> is not one of the
   * possible expressions allowed in a conditional expression.<br>
   * "<code>HAVING e.age BETWEEN 5 AND 18</code>" is complete.<br>
   * "<code>HAVING e.age BETWEEN 5 AND</code>" is not complete.
   */
  protected class ConditionalExpressionCompletenessVisitor extends CompletenessVisitor {

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AndExpression expression) {
      complete = expression.hasRightExpression();
      if (complete) {
        complete = isComplete(expression.getRightExpression());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(BetweenExpression expression) {
      complete = expression.hasUpperBoundExpression();
      if (complete) {
        complete = isComplete(expression.getUpperBoundExpression());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionMemberExpression expression) {
      complete = expression.hasCollectionValuedPathExpression();
      if (complete) {
        complete = isComplete(expression.getCollectionValuedPathExpression());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ComparisonExpression expression) {
      complete = expression.hasRightExpression();
      if (complete) {
        complete = isComplete(expression.getRightExpression());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(EmptyCollectionComparisonExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ExistsExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(InExpression expression) {
      complete = expression.hasInItems();
      if (complete) {
        complete = isComplete(expression.getInItems());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LikeExpression expression) {
      complete = isComplete(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullComparisonExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrExpression expression) {
      complete = expression.hasRightExpression();
      if (complete) {
        complete = isComplete(expression.getRightExpression());
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubExpression expression) {
      // It is the first conditional expression, make sure it is a valid conditional expression
      if (!complete) {
        complete = expression.hasRightParenthesis();
        if (complete) {
          expression.getExpression().accept(this);
        }
      }
      // It is not the first conditional expression, simply make sure it has ')'
      else {
        complete = expression.hasRightParenthesis();
      }
    }
  }

  protected class ConstrutorCollectionHelper implements CollectionExpressionHelper<ConstructorExpression> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(ConstructorExpression expression, Expression child, int index) {
      addAllAggregates(ConstructorItemBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(ConstructorExpression expression, int index) {
      addIdentificationVariables(IdentificationVariableType.ALL, expression);
      addAllFunctions(ConstructorItemBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(ConstructorExpression expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getConstructorItems());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(ConstructorExpression expression) {
      return expression.hasLeftParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(ConstructorExpression expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(ConstructorExpression expression) {
      if (expression.hasSpaceAfterNew()) {
        return expression.getClassName().length() + SPACE_LENGTH;
      }
      return expression.getClassName().length();
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(ConstructorExpression expression, int index) {
      return AbstractContentAssistVisitor.this.getQueryBNF(ConstructorItemBNF.ID);
    }
  }

  /**
   * The default implementation of {@link MappingCollector}, which simply returns an empty
   * collection.
   */
  protected class DefaultMappingCollector implements MappingCollector {

    /**
     * Creates a new <code>DefaultMappingCollector</code>.
     */
    protected DefaultMappingCollector() {
      super();
    }

    /**
     * {@inheritDoc}
     */
    public Collection<IMapping> buildProposals() {
      return Collections.emptyList();
    }
  }

  protected class DeleteClauseHelper implements ClauseHelper<DeleteClause> {

    /**
     * Creates a new <code>DeleteClauseHelper</code>.
     */
    protected DeleteClauseHelper() {
      super();
    }

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfExpression(DeleteClause expression) {
      addIdentifier(WHERE);
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(DeleteClause expression) {
      addEntities();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(DeleteClause expression) {
      return expression.getRangeVariableDeclaration();
    }
  }

  protected class DoubleEncapsulatedCollectionHelper implements CollectionExpressionHelper<AbstractDoubleEncapsulatedExpression> {

    /**
     * Creates a new <code>DoubleEncapsulatedCollectionHelper</code>.
     */
    protected DoubleEncapsulatedCollectionHelper() {
      super();
    }

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(AbstractDoubleEncapsulatedExpression expression,
                                   Expression child,
                                   int index) {

      if (queryBNF(expression, index).handleAggregate()) {
        addAllAggregates(queryBNF(expression, index));
      }
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(AbstractDoubleEncapsulatedExpression expression, int index) {
      addAllIdentificationVariables();
      addAllFunctions(queryBNF(expression, index));
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(AbstractDoubleEncapsulatedExpression expression) {
      return expression.buildCollectionExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(AbstractDoubleEncapsulatedExpression expression) {
      return expression.hasLeftParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(AbstractDoubleEncapsulatedExpression expression) {
      // Both MOD and NULLIF allows a fixed 2 encapsulated expressions
      return 2;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(AbstractDoubleEncapsulatedExpression expression) {
      return 0;
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(AbstractDoubleEncapsulatedExpression expression, int index) {
      return getQueryBNF(expression.parameterExpressionBNF(index));
    }
  }

  /**
   * This {@link MappingCollector} returns the possible mappings (non-collection type or
   * collection type) from a managed type.
   */
  protected class FilteringMappingCollector implements MappingCollector {

    /**
     * The {@link Filter} used to filter out either the collection type properties or the non-
     * collection type properties.
     */
    protected final Filter<IMapping> filter;

    /**
     * This resolver is used to retrieve the managed type, which is the parent path of this one.
     */
    protected final Resolver resolver;

    /**
     * The suffix is used to determine if the mapping name needs to be filtered out or not.
     */
    protected final String suffix;

    /**
     * Creates a new <code>FilteringMappingCollector</code>.
     *
     * @param resolver This resolver is used to retrieve the managed type, which is the parent
     * path of this one
     * @param filter The filter used to filter out either the collection type properties or the
     * non-collection type properties
     * @param suffix The suffix is used to determine if the property name needs to be filtered out
     * or not
     */
    FilteringMappingCollector(Resolver resolver, Filter<IMapping> filter, String suffix) {
      super();
      this.filter   = filter;
      this.suffix   = suffix;
      this.resolver = resolver;
    }

    protected void addFilteredMappings(IManagedType managedType, List<IMapping> mappings) {

      Filter<IMapping> filter = buildFilter(suffix);

      for (IMapping mapping : managedType.mappings()) {
        if (filter.accept(mapping)) {
          mappings.add(mapping);
        }
      }
    }

    protected Filter<IMapping> buildFilter(String suffix) {
      if (suffix.length() == 0) {
        return filter;
      }
      return new AndFilter<IMapping>(filter, buildMappingNameFilter(suffix));
    }

    protected Filter<IMapping> buildMappingNameFilter(final String suffix) {
      return new Filter<IMapping>() {
        public boolean accept(IMapping mapping) {
          return mapping.getName().startsWith(suffix);
        }
      };
    }

    /**
     * {@inheritDoc}
     */
    public Collection<IMapping> buildProposals() {

      IManagedType managedType = resolver.getManagedType();

      if (managedType == null) {
        return Collections.emptyList();
      }

      ArrayList<IMapping> mappings = new ArrayList<IMapping>();
      addFilteredMappings(managedType, mappings);
      return mappings;
    }
  }

  protected class FromClauseCollectionHelper implements CollectionExpressionHelper<AbstractFromClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(AbstractFromClause expression, Expression child, int index) {
      addJoinIdentifiers();
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(AbstractFromClause expression, int index) {
      addEntities();
      if (index > 0) {
        addIdentifier(IN);
      }
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(AbstractFromClause expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getDeclaration());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(AbstractFromClause expression) {
      return expression.hasSpaceAfterFrom();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(AbstractFromClause expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(AbstractFromClause expression) {
      return 0;
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(AbstractFromClause expression, int index) {
      return getQueryBNF(expression.declarationBNF());
    }
  }

  protected class FromClauseHelper implements ClauseHelper<AbstractFromClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfExpression(AbstractFromClause expression) {
      // TODO?
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(AbstractFromClause expression) {

      addEntities();

      // With the correction, check to see if the possible identifiers (IN)
      // can be added and only if it's not the first item in the list
      if (positionInCollections.peek() > 0) {
        addAllIdentifiers(InternalFromClauseBNF.ID);
      }
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(AbstractFromClause expression) {
      return expression.getDeclaration();
    }
  }

  protected class FromClauseSelectStatementHelper extends AbstractFromClauseSelectStatementHelper<SelectStatement> {

    /**
     * {@inheritDoc}
     */
    @Override
    protected boolean addAppendableToCollection(SelectStatement expression, int position) {

      boolean skip = super.addAppendableToCollection(expression, position);

      if (!skip && (wordParser.endsWith(position, "ORDER") ||
                    wordParser.endsWith(position, "ORDER B"))) {

        if (!expression.hasWhereClause() &&
           !expression.hasHavingClause()) {

          proposals.addIdentifier(ORDER_BY);
        }

        return true;
      }

      return false;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    protected void addClauseIdentifierProposals(SelectStatement expression) {

      addIdentifier(WHERE);

      if (!expression.hasWhereClause()) {
        addIdentifier(GROUP_BY);

        if (!expression.hasGroupByClause()) {
          addIdentifier(HAVING);

          if (!expression.hasHavingClause()) {
            addIdentifier(ORDER_BY);
          }
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public WhereClauseSelectStatementHelper getNextHelper() {
      return whereClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public SelectClauseSelectStatementHelper getPreviousHelper() {
      return getSelectClauseSelectStatementHelper();
    }
  }

  protected class GroupByClauseCollectionHelper implements CollectionExpressionHelper<GroupByClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(GroupByClause expression, Expression child, int index) {
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(GroupByClause expression, int index) {
      addAllFunctions(GroupByItemBNF.ID);
      addAllIdentificationVariables();
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(GroupByClause expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getGroupByItems());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(GroupByClause expression) {
      return expression.hasSpaceAfterGroupBy();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(GroupByClause expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(GroupByClause expression) {
      return 0;
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(GroupByClause expression, int index) {
      return AbstractContentAssistVisitor.this.getQueryBNF(GroupByItemBNF.ID);
    }
  }

  protected class GroupByClauseSelectStatementHelper extends AbstractGroupByClauseSelectStatementHelper<SelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SelectStatement expression,
                                          GroupByClause clause,
                                          int position,
                                          boolean complete) {

      if (complete || isAppendable(clause)) {
        addIdentifier(HAVING);

        if (!expression.hasHavingClause()) {
          addIdentifier(ORDER_BY);
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public HavingClauseSelectStatementHelper getNextHelper() {
      return getHavingClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public WhereClauseSelectStatementHelper getPreviousHelper() {
      return whereClauseSelectStatementHelper();
    }
  }

  protected class HavingClauseHelper implements ClauseHelper<HavingClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfExpression(HavingClause expression) {
      addAllAggregates(ConditionalExpressionBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(HavingClause expression) {
      addAllIdentificationVariables();
      addAllFunctions(ConditionalExpressionBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(HavingClause expression) {
      return expression.getConditionalExpression();
    }
  }

  protected class HavingClauseSelectStatementHelper extends AbstractHavingClauseSelectStatementHelper<SelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SelectStatement expression,
                                          HavingClause clause,
                                          int position,
                                          boolean complete) {

      if (complete || isAppendable(clause)) {
        addIdentifier(ORDER_BY);
      }
    }

    /**
     * {@inheritDoc}
     */
    public OrderByClauseSelectStatementHelper getNextHelper() {
      return getOrderByClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public GroupByClauseSelectStatementHelper getPreviousHelper() {
      return getGroupByClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(SelectStatement expression) {
      return expression.hasSpaceBeforeOrderBy();
    }
  }

  /**
   * The various ways of retrieving identification variables from the declaration expression.
   */
  protected enum IdentificationVariableType {

    /**
     * Retrieves all the identification variables declared in the declaration portion of the
     * expression, which is either in the <b>FROM</b> clause of a <b>SELECT</b> query or
     * <b>DELETE</b> query or in the <b>UPDATE</b> query.
     */
    ALL,

    /**
     * Only retrieves the identification variables that map a path expression defined in a
     * <b>JOIN</b> expression or in a <b>IN</b> expression.
     */
    COLLECTION,

    /**
     * Only retrieves the identification variables that have been declared to the left of the
     * expression requested them, both range and collection type variables are collected.
     */
    LEFT,

    /**
     * Only retrieves the identification variables that map a path expression defined in a
     * <b>JOIN</b> expression or in a <b>IN</b> expression but that have been declared to the
     * left of the expression requested them.
     */
    LEFT_COLLECTION,

    /**
     * Simply indicate the identification variables should not be collected.
     */
    NONE,

    /**
     * Retrieves the result variables that have been defined in the <b>SELECT</b> clause.
     */
    RESULT_VARIABLE
  }

  protected class IncompleteCollectionExpressionVisitor extends CompletenessVisitor {

    /**
     * This flag is used to make sure only the last expression in a collection is tested. A single
     * expression cannot be used to check the "completeness".
     */
    protected boolean insideCollection;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {

      int lastIndex = expression.childrenSize() - 1;
      insideCollection = true;

      if (!expression.hasComma(lastIndex - 1)) {
        expression.getChild(lastIndex).accept(this);
      }

      insideCollection = false;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(FromClause expression) {
      expression.getDeclaration().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(GroupByClause expression) {
      expression.getGroupByItems().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(HavingClause expression) {
      expression.getConditionalExpression().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariable expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariableDeclaration expression) {
      if (insideCollection && !expression.hasJoins()) {
        expression.getRangeVariableDeclaration().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(RangeVariableDeclaration expression) {

      if (insideCollection) {

        // The abstract schema name could be "GROUP" or "ORDER" and as the last declaration,
        // GROUP BY and ORDER BY becomes valid proposals
        complete = !expression.hasAs() && !expression.hasIdentificationVariable();

        // Special cases
        if (!complete) {
          complete = expression.toParsedText().equalsIgnoreCase("GROUP B") ||
                     expression.toParsedText().equalsIgnoreCase("ORDER B");
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(WhereClause expression) {
      expression.getConditionalExpression().accept(this);
    }
  }

  protected class JoinCollectionHelper implements CollectionExpressionHelper<IdentificationVariableDeclaration> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(IdentificationVariableDeclaration expression,
                                   Expression child,
                                   int index) {
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(IdentificationVariableDeclaration expression, int index) {
      addJoinIdentifiers();
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(IdentificationVariableDeclaration expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getJoins());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(IdentificationVariableDeclaration expression) {
      return expression.hasSpace();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(IdentificationVariableDeclaration expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(IdentificationVariableDeclaration expression) {
      return length(expression.getRangeVariableDeclaration());
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(IdentificationVariableDeclaration expression, int index) {
      return AbstractContentAssistVisitor.this.getQueryBNF(InternalJoinBNF.ID);
    }
  }

  /**
   * A collector is responsible to retrieve the possible proposals by using the mappings that can
   * complete a path expression.
   */
  protected interface MappingCollector {

    /**
     * Retrieves the possible proposals that can be used to complete a path expression based on
     * the position of the cursor.
     *
     * @return The possible proposals
     */
    Collection<IMapping> buildProposals();
  }

  /**
   * This visitor is responsible to create the right {@link Filter} based on the type of the {@link
   * Expression}.
   */
  protected class MappingFilterBuilder extends AbstractTraverseParentVisitor {

    /**
     * The {@link Filter} that will filter the various type of {@link IMapping IMappings} based
     * on the location of the of the path expression within the JPQL query.
     */
    protected Filter<IMapping> filter;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionMemberDeclaration expression) {
      filter = getMappingCollectionFilter();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionValuedPathExpression expression) {
      filter = getMappingCollectionFilter();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(Join expression) {
      filter = getMappingCollectionFilter();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(JPQLExpression expression) {
      filter = getMappingPropertyFilter();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SizeExpression expression) {
      filter = getMappingCollectionFilter();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TreatExpression expression) {
      filter = getMappingCollectionFilter();
    }
  }

  /**
   * This {@link Filter} is responsible to filter out the mappings that can't have their type
   * assignable to the one passed in.
   */
  protected class MappingTypeFilter implements Filter<IMapping> {

    /**
     * The type used to determine if the mapping's type is a valid type.
     */
    protected final IType type;

    /**
     * Creates a new <code>MappingTypeFilter</code>.
     *
     * @param type The type used to determine if the mapping's type is a valid type
     */
    MappingTypeFilter(IType type) {
      super();
      this.type = type;
    }

    /**
     * {@inheritDoc}
     */
    public boolean accept(IMapping value) {

      // A reference mapping always can be used for further traversal
      if (value.isRelationship() &&
         !value.isCollection()) {

        return true;
      }

      // Determine if it's assignable to the desired type
      IType mappingType = value.getType();
      mappingType = getTypeHelper().convertPrimitive(mappingType);
      return mappingType.isAssignableTo(type);
    }
  }

  /**
   * This visitor checks to see if the visited expression is {@link NullExpression}.
   */
  protected static class NullExpressionVisitor extends AbstractExpressionVisitor {

    /**
     * The {@link NullExpression} if it is the {@link Expression} that was visited.
     */
    protected NullExpression expression;

    /**
     * Creates a new <code>NullExpressionVisitor</code>.
     */
    protected NullExpressionVisitor() {
      super();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullExpression expression) {
      this.expression = expression;
    }
  }

  protected class OrderByClauseCollectionHelper implements CollectionExpressionHelper<OrderByClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(OrderByClause expression, Expression child, int index) {

      OrderByItem item = (OrderByItem) child;

      if (item.getOrdering() == Ordering.DEFAULT) {
        addIdentifier(ASC);
        addIdentifier(DESC);
      }
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(OrderByClause expression, int index) {
      addAllIdentificationVariables();
      addAllResultVariables();
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(OrderByClause expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getOrderByItems());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(OrderByClause expression) {
      return expression.hasSpaceAfterOrderBy();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(OrderByClause expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(OrderByClause expression) {
      return 0;
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(OrderByClause expression, int index) {
      return AbstractContentAssistVisitor.this.getQueryBNF(OrderByItemBNF.ID);
    }
  }

  protected class OrderByClauseSelectStatementHelper implements SelectStatementHelper<SelectStatement, OrderByClause> {

    /**
     * {@inheritDoc}
     */
    public void addClauseProposal() {
      addIdentifier(ORDER_BY);
    }

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SelectStatement expression,
                                          OrderByClause clause,
                                          int position,
                                          boolean complete) {

      // Nothing to add
    }

    /**
     * {@inheritDoc}
     */
    public OrderByClause getClause(SelectStatement expression) {
      return (OrderByClause) expression.getOrderByClause();
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(OrderByClause clause) {
      return clause.getOrderByItems();
    }

    /**
     * {@inheritDoc}
     */
    public SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression> getNextHelper() {
      return null;
    }

    /**
     * {@inheritDoc}
     */
    public HavingClauseSelectStatementHelper getPreviousHelper() {
      return getHavingClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClause(SelectStatement expression) {
      return expression.hasOrderByClause();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasClauseExpression(OrderByClause clause) {
      return clause.hasOrderByItems();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(SelectStatement expression) {
      return false;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceBeforeClause(SelectStatement expression) {
      return expression.hasSpaceBeforeOrderBy();
    }

    /**
     * {@inheritDoc}
     */
    public boolean isClauseExpressionComplete(Expression expression) {
      return false;
    }
  }

  protected class PropertyMappingFilter implements Filter<IMapping> {

    /**
     * {@inheritDoc}
     */
    public boolean accept(IMapping value) {
      return !value.isTransient() &&
             !value.isCollection();
    }
  }

  protected class RangeVariableDeclarationVisitor extends AbstractExpressionVisitor {

    /**
     * The {@link RangeVariableDeclaration} if it was visited otherwise <code>null</code>.
     */
    RangeVariableDeclaration expression;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(RangeVariableDeclaration expression) {
      this.expression = expression;
    }
  }

  protected class ResultVariableVisitor extends AbstractExpressionVisitor {

    /**
     * The {@link ResultVariable} if it was visited otherwise <code>null</code>.
     */
    protected ResultVariable expression;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ResultVariable expression) {
      this.expression = expression;
    }
  }

  /**
   * This visitor checks the integrity of the select items.
   * <p>
   * The possible JPQL identifiers allowed in a SELECT expression as of JPA 2.0
   * are:
   * <ul>
   * <li> *, /, +, -
   * <li> ABS
   * <li> AVG
   * <li> CASE
   * <li> COALESCE
   * <li> CONCAT
   * <li> COUNT
   * <li> CURRENT_DATE, CURRENT_TIME, CURRENT_TIMESTAMP, SQL date
   * <li> ENTRY
   * <li> FUNC
   * <li> INDEX
   * <li> KEY
   * <li> LENGTH
   * <li> LOCATE
   * <li> LOWER
   * <li> MAX
   * <li> MIN
   * <li> MOD
   * <li> NEW
   * <li> NULL
   * <li> NULLIF
   * <li> OBJECT
   * <li> SIZE
   * <li> SQRT
   * <li> SUBSTRING
   * <li> SUM
   * <li> TRIM
   * <li> TRUE, FALSE
   * <li> TYPE
   * <li> UPPER
   * <li> VALUE
   * </ul>
   */
  protected class SelectClauseCompletenessVisitor extends CompletenessVisitor {

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AbsExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AdditionExpression expression) {
      visitArithmeticExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AvgFunction expression) {
      visitAggregateFunction(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CaseExpression expression) {
      complete = expression.hasEnd();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CoalesceExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionExpression expression) {

      // "SELECT e," is complete
      if (expression.endsWithComma()) {
        complete = true;
      }

      int lastIndex = expression.childrenSize() - 1;
      AbstractExpression child = (AbstractExpression) expression.getChild(lastIndex);

      // The collection ends with an empty element, that's not complete
      if (isNull(child)) {
        complete = false;
      }
      else {
        int length = expression.toActualText(positionInCollections.peek()).length();

        // The position is at the beginning of the child expression, that means
        // it's complete because we don't have to verify the child expression
        if (corrections.peek() == length) {
          int index = Math.max(0, positionInCollections.peek() - 1);
          complete = expression.hasComma(index);
        }
        // Dig into the child expression to check its status
        else {
          child.accept(this);
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ConcatExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ConstructorExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CountFunction expression) {
      visitAggregateFunction(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(DateTime expression) {
      // Always complete if CURRENT_DATE, CURRENT_TIME, CURRENT_TIMESTAMP
      // or if the JDBC escape syntax ends with '}'
      complete = expression.isJDBCDate() ? expression.toActualText().endsWith("}") : true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(DivisionExpression expression) {
      visitArithmeticExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(EntryExpression expression) {
      visitEncapsulatedIdentificationVariableExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariable expression) {
      // Always complete
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IndexExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(KeyExpression expression) {
      visitEncapsulatedIdentificationVariableExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(KeywordExpression expression) {
      // Always complete
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LengthExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LocateExpression expression) {
      visitAbstractTripleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LowerExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MaxFunction expression) {
      visitAggregateFunction(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MinFunction expression) {
      visitAggregateFunction(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ModExpression expression) {
      visitAbstractDoubleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MultiplicationExpression expression) {
      visitArithmeticExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullIfExpression expression) {
      visitAbstractDoubleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ObjectExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ResultVariable expression) {
      complete = expression.hasResultVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SelectClause expression) {

      int position = getPosition(expression);

      if (position == SELECT.length() + SPACE_LENGTH) {
        complete = true;
      }
      else {
        expression.getSelectExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SimpleSelectClause expression) {
      expression.getSelectExpression().accept(this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SizeExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SqrtExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(StateFieldPathExpression expression) {
      // Always complete, even if it ends with a dot
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubstringExpression expression) {
      visitAbstractTripleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubtractionExpression expression) {
      visitArithmeticExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SumFunction expression) {
      visitAggregateFunction(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TrimExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TypeExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(UpperExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ValueExpression expression) {
      visitEncapsulatedIdentificationVariableExpression(expression);
    }

    protected void visitAbstractDoubleEncapsulatedExpression(AbstractDoubleEncapsulatedExpression expression) {
      visitAbstractEncapsulatedExpression(expression);
    }

    protected void visitAbstractEncapsulatedExpression(AbstractEncapsulatedExpression expression) {
      // If ')' is present, then anything can be added after
      complete = expression.hasRightParenthesis();
    }

    protected void visitAbstractSingleEncapsulatedExpression(AbstractSingleEncapsulatedExpression expression) {
      visitAbstractEncapsulatedExpression(expression);
    }

    protected void visitAbstractTripleEncapsulatedExpression(AbstractTripleEncapsulatedExpression expression) {
      visitAbstractEncapsulatedExpression(expression);
    }

    protected void visitAggregateFunction(AggregateFunction expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }

    protected void visitArithmeticExpression(ArithmeticExpression expression) {
      expression.getRightExpression().accept(this);
    }

    protected void visitEncapsulatedIdentificationVariableExpression(EncapsulatedIdentificationVariableExpression expression) {
      visitAbstractSingleEncapsulatedExpression(expression);
    }
  }

  protected class SelectClauseSelectStatementHelper extends AbstractSelectClauseSelectStatementHelper {

    /**
     * {@inheritDoc}
     */
    public FromClauseSelectStatementHelper getNextHelper() {
      return getFromClauseSelectStatementHelper();
    }
  }

  protected interface SelectStatementHelper<T extends AbstractSelectStatement, C extends Expression> {

    /**
     * Adds the JPQL identifier of the clause being scanned by this helper.
     */
    void addClauseProposal();

    /**
     * The position of the cursor is at the end of the given clause, requests to add the clauses'
     * identifiers that can be added as proposals.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     * @param clause The clause being scanned
     * @param position The position of the cursor within the {@link AbstractSelectStatement}
     * @param complete Determines whether the clause's expression is complete or not
     */
    void appendNextClauseProposals(T expression, C clause, int position, boolean complete);

    /**
     * Returns the clause being scanned by this helper. It is safe to type cast the clause because
     * {@link #hasClause(AbstractSelectStatement)} is called before this one.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     * @return The clause being scanned
     */
    C getClause(T expression);

    /**
     * Returns the clause's expression.
     *
     * @param clause The {@link AbstractSelectStatement} being visited
     * @return The clause's expression
     */
    Expression getClauseExpression(C clause);

    /**
     * Returns the {@link SelectStatementHelper} that will scan the following clause, which is
     * based on the grammar and not on the actual existence of the clause in the parsed tree.
     *
     * @return The {@link SelectStatementHelper} for the next clause
     */
    SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression> getNextHelper();

    /**
     * Returns the {@link SelectStatementHelper} that will scan the previous clause, which is
     * based on the grammar and not on the actual existence of the clause in the parsed tree.
     *
     * @return The {@link SelectStatementHelper} for the previous clause
     */
    SelectStatementHelper<? extends AbstractSelectStatement, ? extends Expression> getPreviousHelper();

    /**
     * Determines whether the clause exists in the parsed tree.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     * @return <code>true</code> if the clause has been parsed; <code>false</code> otherwise
     */
    boolean hasClause(T expression);

    /**
     * Determines whether the clause's expression exists in the parsed tree.
     *
     * @param clause The clause being scanned
     * @return <code>true</code> if the clause has its expression or a portion of it parsed;
     * <code>false</code> if nothing was parsed
     */
    boolean hasClauseExpression(C clause);

    /**
     * Determines whether there is a space (owned by the <b>SELECT</b> statement) after the clause
     * being scanned by this helper.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     * @return <code>true</code> if a space follows the clause; <code>false</code> otherwise
     */
    boolean hasSpaceAfterClause(T expression);

    /**
     * Determines whether there is a space (owned by the <b>SELECT</b> statement) before the
     * clause being scanned by this helper.
     *
     * @param expression The {@link AbstractSelectStatement} being visited
     * @return <code>true</code> if a space precedes the clause; <code>false</code> otherwise
     */
    boolean hasSpaceBeforeClause(T expression);

    /**
     * Determines whether the clause's expression is complete or incomplete.
     *
     * @param expression The clause's expression to verify its completeness
     * @return <code>true</code> if the {@link Expression} is complete based on its content versus
     * what the grammar expects; <code>false</code> otherwise
     */
    boolean isClauseExpressionComplete(Expression expression);
  }

  protected class SimpleFromClauseSelectStatementHelper extends AbstractFromClauseSelectStatementHelper<SimpleSelectStatement> {

    /**
     * {@inheritDoc}
     */
    @Override
    protected boolean addAppendableToCollection(SimpleSelectStatement expression, int position) {

      if (wordParser.endsWith(position, "GROUP") ||
          wordParser.endsWith(position, "GROUP B")) {

        if (!expression.hasWhereClause()) {
          proposals.addIdentifier(GROUP_BY);
        }

        return true;
      }

      return false;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    protected void addClauseIdentifierProposals(SimpleSelectStatement expression) {

      addIdentifier(WHERE);

      if (!expression.hasWhereClause()) {
        addIdentifier(GROUP_BY);

        if (!expression.hasGroupByClause()) {
          addIdentifier(HAVING);
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public SimpleWhereClauseSelectStatementHelper getNextHelper() {
      return getSimpleWhereClauseSelectStatementHelper();
    }


    /**
     * {@inheritDoc}
     */
    public SimpleSelectClauseSelectStatementHelper getPreviousHelper() {
      return getSimpleSelectClauseSelectStatementHelper();
    }
  }

  protected class SimpleGroupByClauseSelectStatementHelper extends AbstractGroupByClauseSelectStatementHelper<SimpleSelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SimpleSelectStatement expression,
                                          GroupByClause clause,
                                          int position,
                                          boolean complete) {

      if (complete || isAppendable(clause)) {
        addIdentifier(HAVING);
      }
    }

    /**
     * {@inheritDoc}
     */
    public SimpleHavingClauseSelectStatementHelper getNextHelper() {
      return getSimpleHavingClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public SimpleWhereClauseSelectStatementHelper getPreviousHelper() {
      return getSimpleWhereClauseSelectStatementHelper();
    }
  }

  protected class SimpleHavingClauseSelectStatementHelper extends AbstractHavingClauseSelectStatementHelper<SimpleSelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SimpleSelectStatement expression,
                                          HavingClause clause,
                                          int position,
                                          boolean complete) {
    }

    /**
     * {@inheritDoc}
     */
    public SelectStatementHelper<AbstractSelectStatement, Expression> getNextHelper() {
      return null;
    }

    /**
     * {@inheritDoc}
     */
    public SimpleGroupByClauseSelectStatementHelper getPreviousHelper() {
      return getSimpleGroupByClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasSpaceAfterClause(SimpleSelectStatement expression) {
      return false;
    }
  }

  protected class SimpleSelectClauseSelectStatementHelper extends AbstractSelectClauseSelectStatementHelper {

    /**
     * {@inheritDoc}
     */
    public SimpleFromClauseSelectStatementHelper getNextHelper() {
      return getSimpleFromClauseSelectStatementHelper();
    }
  }

  protected class SimpleWhereClauseSelectStatementHelper extends AbstractWhereClauseSelectStatementHelper<SimpleSelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SimpleSelectStatement expression,
                                          WhereClause clause,
                                          int position,
                                          boolean complete) {


      if (complete || isAppendable(clause)) {
        addIdentifier(GROUP_BY);

        if (!expression.hasGroupByClause()) {
          addIdentifier(HAVING);
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public SimpleGroupByClauseSelectStatementHelper getNextHelper() {
      return getSimpleGroupByClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public SimpleFromClauseSelectStatementHelper getPreviousHelper() {
      return getSimpleFromClauseSelectStatementHelper();
    }
  }

  /**
   * This visitor determines if an {@link Expression} is in a subquery.
   */
  protected class SubqueryVisitor extends AbstractTraverseParentVisitor {

    /**
     * The subquery {@link Expression} if it's the first clause visitor. Otherwise it will be
     * <code>null</code> if the {@link Expression} is in the top-level query.
     */
    SimpleSelectStatement expression;

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SimpleSelectStatement expression) {
      this.expression = expression;
    }
  }

  protected class TrailingCompletenessVisitor extends CompletenessVisitor {

     /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AbsExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AbstractSchemaName expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AdditionExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AllOrAnyExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AndExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ArithmeticFactor expression) {

      complete = expression.hasExpression();

      if (complete) {
        expression.getExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(AvgFunction expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(BetweenExpression expression) {

      complete = expression.hasAnd() && expression.hasUpperBoundExpression();

      if (complete) {
        expression.getUpperBoundExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CaseExpression expression) {
      complete = expression.hasEnd();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CoalesceExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionMemberDeclaration expression) {
      complete = expression.hasIdentificationVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionMemberExpression expression) {

      complete = expression.hasCollectionValuedPathExpression();

      if (complete) {
        expression.getCollectionValuedPathExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CollectionValuedPathExpression expression) {
      complete = !expression.endsWithDot();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ComparisonExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ConcatExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ConstructorExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(CountFunction expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(DateTime expression) {
      if (expression.isJDBCDate()) {
        complete = expression.toActualText().endsWith("}");
      }
      else {
        complete = true;
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(DivisionExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(EmptyCollectionComparisonExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(EntityTypeLiteral expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(EntryExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ExistsExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariable expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IdentificationVariableDeclaration expression) {
      if (expression.hasJoins()) {
        expression.getJoins().accept(this);
      }
      else {
        expression.getRangeVariableDeclaration().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(IndexExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(InExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(InputParameter expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(Join expression) {

      if (expression.hasFetch()) {
        if (expression.hasAs()) {
          complete = expression.hasIdentificationVariable();
        }
        else {
          complete = expression.hasJoinAssociationPath();
        }
      }
      else {
        complete = expression.hasIdentificationVariable();
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(KeyExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(KeywordExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LengthExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LikeExpression expression) {
      if (expression.hasEscape()) {
        complete = expression.hasEscapeCharacter();
      }
      else {
        complete = expression.hasPatternValue();
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LocateExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(LowerExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MaxFunction expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MinFunction expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ModExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(MultiplicationExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NotExpression expression) {
      complete = expression.hasExpression();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullComparisonExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NullIfExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(NumericLiteral expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ObjectExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrderByItem expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(OrExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(RangeVariableDeclaration expression) {
      complete = expression.hasIdentificationVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ResultVariable expression) {
      complete = expression.hasResultVariable();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SizeExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SqrtExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(StateFieldPathExpression expression) {
      complete = true;
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(StringLiteral expression) {
      complete = expression.hasCloseQuote();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubstringExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SubtractionExpression expression) {

      complete = expression.hasRightExpression();

      if (complete) {
        expression.getRightExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(SumFunction expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TreatExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TrimExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(TypeExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(UpdateItem expression) {

      complete = expression.hasNewValue();

      if (complete) {
        expression.getNewValue().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(UpperExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(ValueExpression expression) {
      complete = expression.hasRightParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(WhenClause expression) {

      complete = expression.hasThenExpression();

      if (complete) {
        expression.getThenExpression().accept(this);
      }
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(WhereClause expression) {

      complete = expression.hasConditionalExpression();

      if (complete) {
        expression.getConditionalExpression().accept(this);
      }
    }
  }

  protected class TripleEncapsulatedCollectionHelper implements CollectionExpressionHelper<AbstractTripleEncapsulatedExpression> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(AbstractTripleEncapsulatedExpression expression,
                                   Expression child,
                                   int index) {

      if (queryBNF(expression, index).handleAggregate()) {
        addAllAggregates(queryBNF(expression, index));
      }
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(AbstractTripleEncapsulatedExpression expression, int index) {
      addAllIdentificationVariables();
      addAllFunctions(queryBNF(expression, index));
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(AbstractTripleEncapsulatedExpression expression) {
      return expression.buildCollectionExpression();
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(AbstractTripleEncapsulatedExpression expression) {
      return expression.hasLeftParenthesis();
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(AbstractTripleEncapsulatedExpression expression) {
      // Both LOCATE and SUBSTRING can allow up to 3 encapsulated expressions
      return 3;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(AbstractTripleEncapsulatedExpression expression) {
      return 0;
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(AbstractTripleEncapsulatedExpression expression, int index) {
      return getQueryBNF(expression.parameterExpressionBNF(index));
    }
  }

  protected class UpdateItemCollectionHelper implements CollectionExpressionHelper<UpdateClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfChild(UpdateClause expression, Expression child, int index) {
      addAllAggregates(NewValueBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(UpdateClause expression, int index) {
      addAllIdentificationVariables();
    }

    /**
     * {@inheritDoc}
     */
    public CollectionExpression buildCollectionExpression(UpdateClause expression) {
      CollectionExpression collectionExpression = getCollectionExpression(expression.getUpdateItems());
      if (collectionExpression == null) {
        collectionExpression = expression.buildCollectionExpression();
      }
      return collectionExpression;
    }

    /**
     * {@inheritDoc}
     */
    public boolean hasDelimiterAfterIdentifier(UpdateClause expression) {
      return true;
    }

    /**
     * {@inheritDoc}
     */
    public int maxCollectionSize(UpdateClause expression) {
      return Integer.MAX_VALUE;
    }

    /**
     * {@inheritDoc}
     */
    public int preExpressionLength(UpdateClause expression) {
      // There is a SPACE_LENGTH less, it's added automatically
      return UPDATE.length() +
             SPACE_LENGTH    +
             length(expression.getRangeVariableDeclaration()) +
             SPACE_LENGTH    +
             SET.length();
    }

    /**
     * {@inheritDoc}
     */
    public JPQLQueryBNF queryBNF(UpdateClause expression, int index) {
      return AbstractContentAssistVisitor.this.getQueryBNF(NewValueBNF.ID);
    }
  }

  /**
   * This visitor is meant to adjust the corrections stack when traversing an {@link Expression} in
   * order to increase the list of valid proposals.
   * <p>
   * For instance, if the query is "<code>SELECT e FROM Employee e WHERE IN</code>" and the cursor
   * is at the end of the query, then <code>IN</code> would be parsed with {@link InExpression}.
   * However, due to how {@link AbstractContentAssistVisitor} works, the identifier <code>INDEX</code>
   * is not added as a valid proposal. This visitor adds that functionality.
   */
  protected class VisitParentVisitor extends AnonymousExpressionVisitor {

    /**
     * {@inheritDoc}
     */
    @Override
    protected void visit(Expression expression) {
      expression.getParent().accept(AbstractContentAssistVisitor.this);
    }

    /**
     * {@inheritDoc}
     */
    @Override
    public void visit(InExpression expression) {

      int position = getPosition(expression) - corrections.peek();
      int length = 0;

      if (expression.hasExpression()) {
        length += length(expression.getExpression()) + SPACE_LENGTH;
      }

      // Within "IN"
      if (isPositionWithin(position, length, expression.getIdentifier())) {

        boolean hasOnlyIdentifier = !expression.hasExpression() &&
                                    !expression.hasInItems();

        if (hasOnlyIdentifier) {
          corrections.add(getPosition(expression));
        }

        super.visit(expression);

        if (hasOnlyIdentifier) {
          corrections.pop();
        }
      }
      else {
        super.visit(expression);
      }
    }
  }

  protected class WhereClauseHelper implements ClauseHelper<WhereClause> {

    /**
     * {@inheritDoc}
     */
    public void addAtTheEndOfExpression(WhereClause expression) {

      Expression conditional = expression.getConditionalExpression();

      if (areLogicSymbolsAppendable(conditional)) {
        addAllLogicIdentifiers();
      }

      if (areArithmeticSymbolsAppendable(conditional)) {
        addAllArithmeticIdentifiers();
      }

      if (areComparisonSymbolsAppendable(conditional)) {
        addAllComparisonIdentifiers();
      }

      if (isCompoundable(conditional)) {
        addAllCompounds(ConditionalExpressionBNF.ID);
      }
    }

    /**
     * {@inheritDoc}
     */
    public void addProposals(WhereClause expression) {
      addAllIdentificationVariables();
      addAllFunctions(ConditionalExpressionBNF.ID);
    }

    /**
     * {@inheritDoc}
     */
    public Expression getClauseExpression(WhereClause expression) {
      return expression.getConditionalExpression();
    }
  }

  protected class WhereClauseSelectStatementHelper extends AbstractWhereClauseSelectStatementHelper<SelectStatement> {

    /**
     * {@inheritDoc}
     */
    public void appendNextClauseProposals(SelectStatement expression,
                                          WhereClause clause,
                                          int position,
                                          boolean complete) {


      if (complete || isAppendable(clause)) {
        addIdentifier(GROUP_BY);

        if (!expression.hasGroupByClause()) {
          addIdentifier(HAVING);

          if (!expression.hasHavingClause()) {
            addIdentifier(ORDER_BY);
          }
        }
      }
    }

    /**
     * {@inheritDoc}
     */
    public GroupByClauseSelectStatementHelper getNextHelper() {
      return getGroupByClauseSelectStatementHelper();
    }

    /**
     * {@inheritDoc}
     */
    public FromClauseSelectStatementHelper getPreviousHelper() {
      return getFromClauseSelectStatementHelper();
    }
  }
}
TOP

Related Classes of org.eclipse.persistence.jpa.jpql.AbstractContentAssistVisitor$UpdateItemCollectionHelper

TOP
Copyright © 2018 www.massapi.com. All rights reserved.
All source code are property of their respective owners. Java is a trademark of Sun Microsystems, Inc and owned by ORACLE Inc. Contact coftware#gmail.com.
y>